CAS 499785-48-7

5-chloro-1,3-dimethyl-1H-pyrazole-4-sulfonic acid

Description:

5-Chloro-1,3-dimethyl-1H-pyrazole-4-sulfonic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a sulfonic acid group, which contributes to its acidic properties and enhances its solubility in water. The presence of chlorine and two methyl groups on the pyrazole ring influences its reactivity and potential applications. Typically, compounds like this are utilized in various fields, including pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The sulfonic acid group can act as a strong acid, making it useful in catalysis and as a reagent in chemical reactions. Additionally, the specific substitution pattern on the pyrazole ring can affect the compound's biological activity, making it of interest in medicinal chemistry. Overall, 5-chloro-1,3-dimethyl-1H-pyrazole-4-sulfonic acid is a versatile compound with significant potential in both research and industrial applications.

Formula: C₅H₇ClN₂O₃S

InChI: InChI=1/C5H7ClN2O3S/c1-3-4(12(9,10)11)5(6)8(2)7-3/h1-2H3,(H,9,10,11)

SMILES: Cc1c(c(Cl)n(C)n1)S(=O)(=O)O

5-Chloro-1,3-dimethyl-1H-pyrazole-4-sulfonic acid

CAS: 499785-48-7

5-Chloro-1,3-dimethyl-1H-pyrazole-4-sulfonic acid

Purity: ≥95%

Molecular weight: 210.64g/mol

Ref: 54-OR110683