CAS 4998-15-6
:(4-chlorophenyl)(oxo)acetaldehyde
Description:
(4-Chlorophenyl)(oxo)acetaldehyde, with the CAS number 4998-15-6, is an organic compound characterized by the presence of a chlorophenyl group and an aldehyde functional group. It features a chlorinated aromatic ring, which contributes to its chemical reactivity and potential biological activity. The compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics, while its aldehyde group makes it reactive towards nucleophiles. This compound may be utilized in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals, due to its ability to participate in condensation reactions and other transformations. Additionally, the presence of the chlorine atom can enhance its electrophilic properties, making it a useful intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system.
Formula:C8H5ClO2
InChI:InChI=1/C8H5ClO2/c9-7-3-1-6(2-4-7)8(11)5-10/h1-5H
SMILES:c1cc(ccc1C(=O)C=O)Cl
Synonyms:- Benzeneacetaldehyde, 4-Chloro-Alpha-Oxo-
- (4-Chlorophenyl)(oxo)acetaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-Chlorophenyl)-2-oxoacetaldehyde
CAS:Formula:C8H5ClO2Color and Shape:SolidMolecular weight:168.5771
