CAS 50-79-3
:2,5-Dichlorobenzoic acid
Description:
2,5-Dichlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms positioned at the 2 and 5 positions on the benzene ring relative to the carboxylic acid group. This compound typically appears as a white to off-white crystalline solid and is known for its moderate solubility in water, which can be influenced by pH. It has a melting point that generally falls within a specific range, indicating its solid state at room temperature. 2,5-Dichlorobenzoic acid is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its chemical structure contributes to its reactivity, allowing it to participate in electrophilic substitution reactions and other transformations. Additionally, it is important to handle this substance with care due to its potential environmental and health impacts, as indicated by safety data sheets. Overall, 2,5-Dichlorobenzoic acid is a significant compound in organic chemistry with diverse applications.
Formula:C7H4Cl2O2
InChI:InChI=1/C7H4Cl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)
InChI key:InChIKey=QVTQYSFCFOGITD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=CC(Cl)=C1
Synonyms:- 2,5-Dichlorobenzoate
- Ai3-33415
- Benzoic acid, 2,5-dichloro-
- Brn 0973353
- Ccris 8609
- Nsc 41889
- 2,5-Dichlorobenzoic acid
- 1,2-DICHLOROBENZENE PESTANAL
- 2,5-Dichlorobenzoic acid, 98+%
- 2,5-Dichlorobenzoic acid ,99%
- 2,5-dichloro-benzoicaci
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,5-Dichlorobenzoic Acid
CAS:Formula:C7H4Cl2O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:191.012,5-Dichlorobenzoic acid
CAS:Formula:C7H4Cl2O2Purity:95%Color and Shape:SolidMolecular weight:191.01152,5-Dichlorobenzoic acid
CAS:2,5-Dichlorobenzoic acid
Formula:C7H4Cl2O2Purity:≥95%Color and Shape: white powderMolecular weight:191.01g/mol2,5-Dichlorobenzoic acid
CAS:Formula:C7H4Cl2O2Purity:96%Color and Shape:Beige crystallineMolecular weight:191.012,5-Dichlorobenzoic acid
CAS:2,5-Dichlorobenzoic acid is a hydrogen-bonding agent that interacts with other molecules by forming hydrogen bonds. It reacts with benzoate to form 2,5-dichlorobenzoate, which is an intermediate in the synthesis of phenylbenzene and biphenyl. 2,5-Dichlorobenzoic acid has been shown to inhibit the growth of bacteria such as Stenotrophomonas maltophilia and Pseudomonas aeruginosa. The compound also lowers cholesterol levels in rats and humans.
2,5-Dichlorobenzoic acid has a redox potential of -0.25 V and can be used to reduce sodium hydroxide solution or hydroxide solution. This chemical's structure allows it to be taken up by cells through passive diffusion and active transport mechanisms.Formula:C7H4Cl2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:191.01 g/mol






