CAS 50-80-6
:2-Acetyl-4-aminophenol
Description:
2-Acetyl-4-aminophenol, commonly known as paracetamol or acetaminophen, is an organic compound with the molecular formula C8H9NO2. It is characterized by its white crystalline appearance and is soluble in water, alcohol, and ether. This compound exhibits analgesic (pain-relieving) and antipyretic (fever-reducing) properties, making it widely used in pharmaceuticals. The structure features an acetyl group attached to the amino group of a para-aminophenol, which contributes to its biological activity. Paracetamol is generally well-tolerated, but excessive doses can lead to hepatotoxicity due to the formation of reactive metabolites. It is important to note that while it is effective for mild to moderate pain relief, it does not possess significant anti-inflammatory properties compared to non-steroidal anti-inflammatory drugs (NSAIDs). The compound is often found in various over-the-counter medications and is a key ingredient in many formulations aimed at alleviating pain and reducing fever. Proper dosage and adherence to guidelines are essential to minimize the risk of adverse effects.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,9H2,1H3
InChI key:InChIKey=SXLHPBDGZHWKSX-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(O)C=CC(N)=C1
Synonyms:- 1-(5-Amino-2-hydroxyphenyl)ethanone
- 2-Acetyl-4-aminophenol
- Ethanone, 1-(5-amino-2-hydroxyphenyl)-
- 3-Acetyl-4-hydroxyaniline
- Acetophenone, 5′-amino-2′-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5'-Amino-2'-hydroxyacetophenone
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.16261-(5-Amino-2-hydroxyphenyl)ethan-1-one
CAS:1-(5-Amino-2-hydroxyphenyl)ethan-1-onePurity:95%Molecular weight:151.16g/mol5-Amino-2-hydroxyacetophenone
CAS:5-Amino-2-hydroxyacetophenone is a chemical compound that belongs to the class of active substances. It is an intermediate in Friedel-Crafts acylation reactions, which are used to form alkyl esters by reaction with chloroformates. In these reactions, 5-Amino-2-hydroxyacetophenone is converted into a chloroformate in the presence of an acid catalyst. The reactions proceed rapidly, with the acetone or ester as the solvent. The frequency of 5-amino-2-hydroxyacetophenone can be correlated to its deformation energy and various chemical parameters such as electron density and force constants. 5-Amino-2-hydroxyacetophenone is uniquely characterized by intramolecularly hydrogen bonding organic solvents such as acetone and nitrobenzene.Formula:C8H9NO2Purity:Min. 95%Molecular weight:151.16 g/mol1-(5-Amino-2-hydroxyphenyl)ethanone
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.165




