CAS 50-82-8
:2,4,5-Trichlorobenzoic acid
Description:
2,4,5-Trichlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of three chlorine atoms substituted on the benzene ring at the 2, 4, and 5 positions relative to the carboxylic acid group. This compound appears as a white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. It has a melting point that typically falls within a specific range, indicating its solid state at room temperature. The presence of chlorine atoms contributes to its chemical reactivity and potential environmental persistence, making it of interest in studies related to herbicides and environmental pollutants. 2,4,5-Trichlorobenzoic acid can undergo various chemical reactions, including esterification and nucleophilic substitution, and is often used as an intermediate in the synthesis of other chemical compounds. Safety considerations are important when handling this substance, as it may pose health risks and environmental hazards.
Formula:C7H3Cl3O2
InChI:InChI=1S/C7H3Cl3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=PTFNNDHASFGWFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(Cl)C(Cl)=C1
Synonyms:- Ai3-33332
- Benzoic acid, 2,4,5-trichloro-
- Brn 1871922
- 2,4,5-Trichlorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,5-Trichlorobenzoic acid
CAS:Formula:C7H3Cl3O2Purity:95%Color and Shape:SolidMolecular weight:225.45652,4,5-Trichlorobenzoic acid
CAS:2,4,5-Trichlorobenzoic acidFormula:C7H3Cl3O2Purity:≥95%Color and Shape: off-white powderMolecular weight:225.46g/mol2,4,5-Trichlorobenzoic Acid
CAS:Controlled ProductApplications 2,4,5-trichlorobenzoic acid (cas# 50-82-8) is a useful research chemical.
Formula:C7H3O2Cl3Color and Shape:NeatMolecular weight:225.452,4,5-Trichlorobenzoic acid
CAS:Formula:C7H3Cl3O2Purity:95%Color and Shape:SolidMolecular weight:225.452,4,5-Trichlorobenzoic acid
CAS:2,4,5-Trichlorobenzoic acid is a chlorinated aromatic compound that is used as a reagent in organic chemistry. It reacts with electron-rich arenes to form chloroarenes and can also be used to synthesize biphenyls. 2,4,5-Trichlorobenzoic acid is sensitive to light and can undergo photochemical reactions such as photolysis or electron-induced reactions. The reactive nature of this chemical makes it susceptible to mechanisms such as hydrolysis, oxidation or reduction. 2,4,5-Trichlorobenzoic acid has a constant boiling point of 246 degrees Celsius at atmospheric pressure.
Formula:C7H3Cl3O2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:225.46 g/mol




