CAS 50-84-0
:2,4-Dichlorobenzoic acid
Description:
2,4-Dichlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms positioned at the 2 and 4 positions on a benzoic acid ring. Its molecular formula is C7H4Cl2O2, and it features a carboxylic acid functional group (-COOH) that contributes to its acidic properties. This compound is typically a white crystalline solid with a melting point that varies depending on purity and environmental conditions. It is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. 2,4-Dichlorobenzoic acid is primarily used in the synthesis of herbicides and as an intermediate in organic synthesis. It exhibits herbicidal properties, making it valuable in agricultural applications. Additionally, it can serve as a reagent in various chemical reactions, including the preparation of other chlorinated compounds. Due to its chemical structure, it may also pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C7H4Cl2O2
InChI:InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)
InChI key:InChIKey=ATCRIUVQKHMXSH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=C(Cl)C=C1
Synonyms:- 2,4-Dcba
- 2,4-Dichlolrobenzoic Acid
- 2,4-Dichlorobenzoate
- Benzoic acid, 2,4-dichloro-
- NSC 578
- 2,4-Dichlorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
2,4-Dichlorobenzoic acid, 98%
CAS:<p>2,4-Dichlorobenzoic acid is used as reagent during the synthesis of pyrimido[2?,1?:2,3]thiazolo[4,5-b]quinoxaline derivatives. It is also used as starting reagent during the synthesis of 1-(substituted)-1,4-dihydro-6-nitro-4-oxo-7-(sub-secondary amino)-quinoline-3-carboxylic acids. This Thermo Scien</p>Formula:C7H4Cl2O2Purity:98%Color and Shape:Powder or lumps, WhiteMolecular weight:191.012,4-Dichlorobenzoic Acid
CAS:Formula:C7H4Cl2O2Purity:98%Color and Shape:SolidMolecular weight:191.0115Furosemide EP Impurity E (2,4-Dichlorobenzyl Alcohol EP Impurity E)
CAS:Formula:C7H4Cl2O2Color and Shape:White To Off-White SolidMolecular weight:191.012,4-Dichlorobenzoic acid
CAS:<p>2,4-Dichlorobenzoic acid</p>Formula:C7H4Cl2O2Purity:≥95%Color and Shape: white to off white crystalline solidMolecular weight:191.01g/mol2,4-Dichlorobenzoic acid
CAS:Formula:C7H4Cl2O2Purity:98%Color and Shape:Crystalline,PowderMolecular weight:191.012,4-Dichlorobenzoic Acid
CAS:Formula:C7H4Cl2O2Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:191.012,4-Dichlorobenzoic Acid
CAS:Controlled ProductFormula:C7H4Cl2O2Color and Shape:White SolidMolecular weight:191.012,4-Dichlorobenzoic Acid
CAS:Controlled Product<p>Impurity Furosemide EP Impurity E<br>Applications 2,4-Dichlorobenzoic Acid (Furosemide EP Impurity E) is a di-halogenated benzoic acid derivative and an intermediate in the synthesis of spirodiclofen (S682990), a tetronic acid acaricide fungicide used in controlling red mites.<br>References Cho, Y.C., et al.: FEMS. MIcrobiol. Ecol., 42, 51 (2002); Corbella, M.E., et al.: Biodegradation., 12, 149 (2001);<br></p>Formula:C7H4Cl2O2Color and Shape:White To Off-WhiteMolecular weight:191.012,4-Dichlorobenzoic acid
CAS:<p>2,4-Dichlorobenzoic acid is a chemical compound that is commonly used for sample preparation for analytical methods. It is also used as a nutrient in group P2 bacteria. 2,4-Dichlorobenzoic acid has coordination geometry of octahedral with the central atom being surrounded by six ligands. This chemical has hydrogen bonding interactions that are most likely due to the electronegative chlorine atoms.</p>Formula:C7H4Cl2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:191.01 g/mol2,4-Dichlorobenzoic Acid extrapure, 98%
CAS:Formula:C7H4Cl2O2Purity:min. 98%Color and Shape:White to off-white, Crystalline powder, Clear, Colourless to slight yellowMolecular weight:191.02
