CAS 500-00-5
:p-Menth-3-ene
Description:
p-Menth-3-ene, also known as 3-p-menthene, is a bicyclic monoterpene characterized by its unique structure derived from the menthane framework. It is a colorless to pale yellow liquid with a characteristic minty odor, commonly associated with various essential oils. The compound is primarily found in the essential oils of certain plants, contributing to their aromatic properties. p-Menth-3-ene is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in the fragrance and flavoring industries. Additionally, it exhibits some degree of biological activity, including potential antimicrobial properties. The compound's stability can be influenced by factors such as temperature and exposure to light, which may lead to isomerization or degradation. As with many terpenes, p-Menth-3-ene is of interest in both natural product chemistry and industrial applications, particularly in the formulation of perfumes and flavorings. Safety data indicates that, while generally regarded as safe in low concentrations, appropriate handling and usage guidelines should be followed to mitigate any potential health risks.
Formula:C10H18
InChI:InChI=1S/C10H18/c1-8(2)10-6-4-9(3)5-7-10/h6,8-9H,4-5,7H2,1-3H3
InChI key:InChIKey=YYCPSEFQLGXPCO-UHFFFAOYSA-N
SMILES:C(C)(C)C=1CCC(C)CC1
Synonyms:- 3-p-Menthene
- Menthomenthene
- Cyclohexene, 4-methyl-1-(1-methylethyl)-
- 4-Methyl-1-(1-methylethyl)cyclohexene
- p-Menth-3-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
