CAS 500-12-9

(5S)-5-Ethenyl-2-oxazolidinethione

Description:

(5S)-5-Ethenyl-2-oxazolidinethione, with the CAS number 500-12-9, is a heterocyclic compound characterized by the presence of an oxazolidine ring, which incorporates both sulfur and nitrogen in its structure. This compound features a vinyl group at the 5-position of the oxazolidine ring, contributing to its reactivity and potential applications in organic synthesis. The thione functional group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its chemical behavior, particularly in nucleophilic reactions. The stereochemistry denoted by (5S) suggests that the compound has a specific spatial arrangement, which can affect its biological activity and interactions with other molecules. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, making them of interest in medicinal chemistry. Additionally, the presence of the oxazolidine structure may allow for various modifications, enhancing its utility in synthetic pathways or as a building block in more complex chemical entities.

Formula: C₅H₇NOS

InChI: InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m0/s1

InChI key: InChIKey=UZQVYLOFLQICCT-BYPYZUCNSA-N

SMILES: C(=C)[C@@H]1OC(=S)NC1

Synonyms:

• 2-Oxazolidinethione, 5-vinyl-, (S)-
• 2-Oxazolidinethione, 5-ethenyl-, (5S)-
• 2-Oxazolidinethione, 5-ethenyl-, (S)-
• (S)-5-Vinyloxazolidine-2-thione
• (5S)-5-Ethenyl-2-oxazolidinethione

2-Oxazolidinethione, 5-ethenyl-, (5S)-

CAS: 500-12-9

Formula: C₅H₇NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 129.1802

Ref: IN-DA00DVRT

(S)-5-Vinyloxazolidine-2-thione

CAS: 500-12-9

(S)-5-Vinyloxazolidine-2-thione

Purity: 98%

Molecular weight: 129.18g/mol

Ref: 54-OR1067093

(S)-Goitrin

CAS: 500-12-9

Formula: C₅H₇NOS

Purity: 95%~99%

Molecular weight: 129.177

Ref: BP-BP5138

Goitrin

CAS: 500-12-9

Goitrin, from glucosinolate reactions, blocks thyroid peroxidase and iodine use, and fights H1N1.

Formula: C₅H₇NOS

Color and Shape: Solid

Molecular weight: 129.18

Ref: TM-T73465

Goitrin

CAS: 500-12-9

Goitrin is a natural goitrogenic compound, primarily found in cruciferous vegetables such as broccoli, Brussels sprouts, and cabbage. It is an organic molecule derived from glucosinolates, a class of sulfur-containing compounds. The mode of action of Goitrin involves the inhibition of thyroid hormone synthesis. It interferes with iodine uptake by the thyroid gland, thereby reducing the production of hormones such as thyroxine and triiodothyronine. This effect is primarily due to its structural similarity to thyroxine, allowing it to act as a natural antagonist in the thyroid hormone biosynthesis pathway.

Formula: C₅H₇NOS

Purity: Min. 95%

Molecular weight: 129.18 g/mol

Ref: 3D-XG181270