CAS 500-99-2: 3,5-Dimethoxyphenol
Description:3,5-Dimethoxyphenol, with the CAS number 500-99-2, is an organic compound characterized by a phenolic structure with two methoxy groups (-OCH3) attached to the aromatic ring at the 3 and 5 positions. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. It exhibits properties typical of phenolic compounds, including antioxidant activity and potential applications in various fields such as pharmaceuticals, cosmetics, and as a chemical intermediate. The presence of methoxy groups enhances its electron-donating ability, influencing its reactivity and stability. 3,5-Dimethoxyphenol can undergo typical electrophilic aromatic substitution reactions, making it a versatile building block in organic synthesis. Additionally, it may exhibit biological activities, including antimicrobial and anti-inflammatory effects, which are of interest in medicinal chemistry. Proper handling and safety precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-10-7-3-6(9)4-8(5-7)11-2/h3-5,9H,1-2H3
InChI key:InChIKey=XQDNFAMOIPNVES-UHFFFAOYSA-N
SMILES:OC=1C=C(OC)C=C(OC)C1
- Synonyms:
- 1-Hydroxy-3,5-dimethoxybenzene
- 3,5-Dimethoxy Phenol
- NSC 70955
- Phenol, 3,5-dimethoxy-
- Phloroglucinol dimethyl ether
- Taxicatigenin
- 3,5-Dimethoxyphenol
