CAS 5000-66-8
:2-Bromo-1-(2-chlorophenyl)ethanone
Description:
2-Bromo-1-(2-chlorophenyl)ethanone, with the CAS number 5000-66-8, is an organic compound characterized by its bromine and chlorine substituents on a phenyl ring and an ethanone functional group. This compound typically appears as a solid or liquid, depending on its purity and temperature. It is known for its reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions and substitutions. The bromine and chlorine atoms enhance its electrophilic character, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its handling requires caution due to potential toxicity and environmental impact, necessitating appropriate safety measures during synthesis and application. Overall, 2-Bromo-1-(2-chlorophenyl)ethanone serves as a valuable intermediate in chemical synthesis, with implications in various fields of research and industry.
Formula:C8H6BrClO
InChI:InChI=1S/C8H6BrClO/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4H,5H2
InChI key:InChIKey=WZWWEVCLPKAQTA-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=C(Cl)C=CC=C1
Synonyms:- 2-Bromo-1-(2-Chlorophenyl)Ethanone
- 2-Bromo-1-(2-chlorophenyl)-1-ethanone
- 2-Bromo-1-(2-chlorophenyl)ethan-1-one
- 2-Bromo-o-chloroacetophenone
- 2-Chloro-2'-bromoacetophenone
- 2-Chlorophenacyl bromide
- Acetophenone, 2-bromo-2′-chloro-
- Bromomethyl 2-chlorophenyl ketone
- Ethanone, 2-bromo-1-(2-chlorophenyl)-
- o-Chlorophenacyl bromide
- 2-Bromo-2-chloroacetophenone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromo-2'-chloroacetophenone
CAS:Formula:C8H6BrClOPurity:96%Color and Shape:LiquidMolecular weight:233.48962-Chlorophenacyl bromide,
CAS:2-Chlorophenacyl bromide,Formula:C8H6BrClOPurity:97%Color and Shape: clear. light yellow liquidMolecular weight:233.49g/mol2'-Chloro-2-bromoacetophenone
CAS:2'-Chloro-2-bromoacetophenone is a compound that belongs to the class of methyl ketones. It is known to have a high transfer hydrogenation activity and has been used in the synthesis of phenacyl, which is an important biomolecular. It also has a low toxicity and does not irritate skin or mucous membranes. 2'-Chloro-2-bromoacetophenone can be used as an antiarrhythmic agent for respiratory disorders. This compound can be used for formylation reactions, such as those found in microbial metabolism, due to its ability to transfer hydrogen from organic compounds.Formula:C8H6BrClOPurity:Min. 95%Molecular weight:233.49 g/mol






