CAS 500011-88-1

Ethyl 2-(3-Chloro-2-pyridinyl)-5-oxo-3-pyrazolidinecarboxylate

Description:

Ethyl 2-(3-Chloro-2-pyridinyl)-5-oxo-3-pyrazolidinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyrazolidine ring and a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its bioactive characteristics. The presence of the chloro substituent on the pyridine ring may influence its reactivity and biological activity, potentially enhancing its pharmacological properties. The ethyl ester functional group contributes to its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug development and chemical research.

Formula: C₁₁H₁₂ClN₃O₃

InChI: InChI=1S/C11H12ClN3O3/c1-2-18-11(17)8-6-9(16)14-15(8)10-7(12)4-3-5-13-10/h3-5,8H,2,6H2,1H3,(H,14,16)

InChI key: InChIKey=GWGIBEMOOVJUPI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1N(NC(=O)C1)C2=C(Cl)C=CC=N2

Synonyms:

• Ethyl 2-(3-Chloro-2-pyridinyl)-5-oxo-3-pyrazolidinecarboxylate
• 3-Pyrazolidinecarboxylic acid, 2-(3-chloro-2-pyridinyl)-5-oxo-, ethyl ester
• Ethyl 1-(3-chloro-2-pyridinyl)-3-pyrazolidinone-5-carboxylate
• Ethyl 2-(3-chloro-2-pyridyl)-5-oxopyrazolidine-3-carboxylate

Ethyl 2-(3-Chloro-2-Pyridinyl)-5-Oxo-3-Pyrazolidinecarboxylate

CAS: 500011-88-1

Formula: C₁₁H₁₂ClN₃O₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 269.6843

Ref: IN-DA0039JT

Ethyl 2-(3-Chloropyridin-2-Yl)-5-Oxopyrazolidine-3-Carboxylate

CAS: 500011-88-1

Ethyl 2-(3-Chloropyridin-2-Yl)-5-Oxopyrazolidine-3-Carboxylate

Purity: 98%

Molecular weight: 269.68g/mol

Ref: 54-OR1027214