CymitQuimica logo

CAS 500024-30-6

:

N'-hydroxy-4-(methylsulfanyl)benzenecarboximidamide

Description:
N'-hydroxy-4-(methylsulfanyl)benzenecarboximidamide is a chemical compound characterized by its unique functional groups and structural features. It contains a hydroxylamine group (-NHOH) attached to a benzenecarboximidamide framework, which includes an amine functional group and a carboxylic acid derivative. The presence of a methylsulfanyl group (-S-CH3) introduces a sulfur atom into the structure, contributing to its potential reactivity and biological activity. This compound may exhibit properties such as solubility in polar solvents due to the hydroxyl and amine functionalities, while the aromatic ring can provide stability and influence its interaction with biological targets. Its specific applications and reactivity would depend on the context of its use, such as in medicinal chemistry or as a reagent in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen and sulfur in its structure, which may impart specific toxicological properties.
Formula:C8H10N2OS
InChI:InChI=1/C8H10N2OS/c1-12-7-4-2-6(3-5-7)8(9)10-11/h2-5,11H,1H3,(H2,9,10)
SMILES:CSc1ccc(cc1)C(=NO)N
Synonyms:
  • Benzenecarboximidamide, N'-hydroxy-4-(methylthio)-
  • N'-Hydroxy-4-(methylsulfanyl)benzenecarboximidamide
  • N-Hydroxy-4-(methylthio)benzenecarboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.