CAS 5001-82-1
:Tetrahydro-1,3,4-tris(hydroxymethyl)imidazo[4,5-d]imidazole-2,5(1H,3H)-dione
Description:
Tetrahydro-1,3,4-tris(hydroxymethyl)imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, with CAS number 5001-82-1, is a chemical compound characterized by its complex bicyclic structure, which includes imidazole rings and multiple hydroxymethyl groups. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxymethyl groups that can engage in hydrogen bonding. It exhibits properties typical of imidazole derivatives, including potential biological activity, which may include antimicrobial or antifungal effects. The presence of multiple hydroxymethyl groups enhances its reactivity and may influence its interactions in biological systems. Additionally, the compound may be of interest in pharmaceutical research and development due to its structural features that could be relevant for drug design. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.
Formula:C7H12N4O5
InChI:InChI=1S/C7H12N4O5/c12-1-9-4-5(11(3-14)7(9)16)10(2-13)6(15)8-4/h4-5,12-14H,1-3H2,(H,8,15)
InChI key:InChIKey=IQAIFQCNPCBECX-UHFFFAOYSA-N
SMILES:C(O)N1C2C(N(CO)C1=O)NC(=O)N2CO
Synonyms:- 1,3,4-tris(hydroxymethyl)tetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione
- Glycoluril, 1,3,4-tris(hydroxymethyl)-
- Imidazo(4,5-d)imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4-tris(hydroxymethyl)-
- N-Trimethylolglycoluril
- Protorez 4361
- Trimethylolacetylene diurea
- Trimethylolacetylenediureine
- Tetrahydro-1,3,4-tris(hydroxymethyl)imidazo(4,5-d)imidazole-2,5(1H,3H)-dione
- Tetrahydro-1,3,4-tris(hydroxymethyl)imidazo[4,5-d]imidazole-2,5(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
