CymitQuimica logo

CAS 500139-01-5

:

1H-Indole, 5,7-difluoro-3-iodo-1-(phenylsulfonyl)-

Description:
1H-Indole, 5,7-difluoro-3-iodo-1-(phenylsulfonyl)-, identified by its CAS number 500139-01-5, is a synthetic organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features multiple halogen substituents, specifically fluorine and iodine, which can significantly influence its reactivity and biological activity. The presence of a phenylsulfonyl group enhances its solubility and may contribute to its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The unique combination of functional groups in this molecule may also impart specific electronic and steric properties, making it a subject of interest in research related to drug design and synthesis. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C14H8F2INO2S
InChI:InChI=1S/C14H8F2INO2S/c15-9-6-11-13(17)8-18(14(11)12(16)7-9)21(19,20)10-4-2-1-3-5-10/h1-8H
InChI key:MAJBTMPMUUCYME-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C(=CC(=C3)F)F)I
Found 3 products.