CAS 5002-26-6
:4-Bromo-2-methylbiphenyl
Description:
4-Bromo-2-methylbiphenyl, with the CAS number 5002-26-6, is an organic compound that belongs to the class of biphenyl derivatives. It features a biphenyl structure, which consists of two phenyl rings connected by a single bond, with a bromine atom and a methyl group attached to the aromatic system. The presence of the bromine substituent typically imparts certain reactivity characteristics, making it useful in various chemical syntheses and applications. This compound is generally characterized by its moderate solubility in organic solvents and relatively low solubility in water, reflecting its hydrophobic nature. Its molecular structure contributes to its potential use in materials science, particularly in the development of organic semiconductors and as a building block in organic synthesis. Additionally, 4-Bromo-2-methylbiphenyl may exhibit specific physical properties such as melting and boiling points that are typical of similar aromatic compounds. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental concerns.
Formula:C13H11Br
InChI:InChI=1/C13H11Br/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h2-9H,1H3
SMILES:Cc1cc(ccc1c1ccccc1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Bromo-2-methylbiphenyl, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C13H11BrPurity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:247.144-Bromo-2-methyl-1,1'-biphenyl
CAS:Formula:C13H11BrPurity:95%Color and Shape:LiquidMolecular weight:247.1304


