CymitQuimica logo

CAS 500229-85-6

:

2-(3,5-Difluorophenyl)pyridine

Description:
2-(3,5-Difluorophenyl)pyridine is an organic compound characterized by its pyridine ring substituted with a 3,5-difluorophenyl group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for coordination with metal ions. The presence of the difluorophenyl group enhances its lipophilicity and may influence its electronic properties, making it of interest in medicinal chemistry and material science. The fluorine atoms can impart unique reactivity and stability characteristics, as well as influence the compound's solubility and interaction with biological targets. Typically, compounds like this are evaluated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and the interactions between the functional groups present. Overall, 2-(3,5-Difluorophenyl)pyridine represents a versatile scaffold for further chemical modifications and applications.
Formula:C11H7F2N
InChI:InChI=1S/C11H7F2N/c12-9-5-8(6-10(13)7-9)11-3-1-2-4-14-11/h1-7H
InChI key:InChIKey=JIUDHWMKWZKPTJ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2=CC=CC=N2
Synonyms:
  • 2-(3,5-Difluorophenyl)pyridine
  • Pyridine, 2-(3,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.