CAS 500298-30-6
:1-bromo-3-methoxy-2-nitrobenzene
Description:
1-Bromo-3-methoxy-2-nitrobenzene is an organic compound characterized by the presence of a bromine atom, a methoxy group, and a nitro group attached to a benzene ring. The bromine atom is a halogen, which typically enhances the reactivity of the compound, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group (-OCH3) is an electron-donating group that can influence the compound's reactivity and solubility, often making it more lipophilic. The nitro group (-NO2) is an electron-withdrawing group, which can significantly affect the compound's electronic properties and reactivity, often increasing acidity and making the compound more electrophilic. This compound may exhibit moderate to high stability under standard conditions but can be sensitive to strong reducing agents or extreme conditions. Its unique combination of functional groups allows it to serve as an important intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound due to the potential hazards associated with its components.
Formula:C7H6BrNO3
InChI:InChI=1/C7H6BrNO3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,1H3
Synonyms:- 1-Bromo-3-methoxy-2-nitrobenzene
- 3-Bromo-2-nitrophenyl methyl ether
- WNR BE FO1
- 3-Bromo-2-nitroanisole
- 2-Bromo-6-methoxynitrobenzene
- 500298-30-6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Bromo-2-nitroanisole
CAS:Formula:C7H6BrNO3Purity:>98.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:232.031-Bromo-3-methoxy-2-nitrobenzene
CAS:Formula:C7H6BrNO3Purity:97%Color and Shape:SolidMolecular weight:232.03143-Bromo-2-nitroanisole
CAS:3-Bromo-2-nitroanisoleFormula:C7H6BrNO3Purity:98%Color and Shape: pale lemon crystalline powderMolecular weight:232.03g/mol1-Bromo-3-methoxy-2-nitrobenzene
CAS:Formula:C7H6BrNO3Purity:97%Color and Shape:SolidMolecular weight:232.0333-Bromo-2-nitroanisole
CAS:3-Bromo-2-nitroanisole is a potassium channel blocker that has neuroprotective effects. It can be used for the treatment of glaucoma and hypertension. 3-Bromo-2-nitroanisole can inhibit the activity of potassium channels and act as a neuroprotective agent. The drug has been shown to have neuroprotective effects in animal models, with evidence of efficacy in humans. The drug also inhibits the production of nitric oxide, which may contribute to its neuroprotective effect.
Formula:C7H6BrNO3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:232.03 g/mol






