CAS 5004-45-5

4-phenylphthalazin-1(2H)-one

Description:

4-Phenylphthalazin-1(2H)-one is an organic compound characterized by its phthalazinone structure, which consists of a phthalazine ring system with a phenyl substituent at the 4-position. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. It may display various functional properties, including fluorescence and reactivity due to the presence of the carbonyl group in the phthalazinone moiety. The compound's solubility can vary depending on the solvent, often being more soluble in organic solvents than in water. Its chemical behavior can be influenced by the presence of the phenyl group, which can affect electronic properties and steric hindrance. Additionally, 4-phenylphthalazin-1(2H)-one may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₄H₁₀N₂O

InChI: InChI=1/C14H10N2O/c17-14-12-9-5-4-8-11(12)13(15-16-14)10-6-2-1-3-7-10/h1-9H,(H,16,17)

SMILES: c1ccc(cc1)c1c2ccccc2c(nn1)O

Synonyms:

• 1(2H)-Phthalazinone, 4-phenyl-
• 1-Phthalazinol, 4-Phenyl-
• 4-Phenyl-1,2-Dihydrophthalazin-1-One

4-Phenyl-1(2h)-phthalazinone

CAS: 5004-45-5

Formula: C₁₄H₁₀N₂O

Purity: %

Color and Shape: Solid

Molecular weight: 222.2420

Ref: IN-DA003LZ0

4-Phenylphthalazin-1(2H)-One

CAS: 5004-45-5

4-Phenylphthalazin-1(2H)-One

Purity: 99%

Molecular weight: 222.24g/mol

Ref: 54-OR1011662

4-phenyl-2-hydrophthalazin-1-one, 98%

CAS: 5004-45-5

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 222.2469940185547

Ref: 10-F340764

4-phenyl-1(2h)-phthalazinone

CAS: 5004-45-5

4-Phenyl-1(2H)-phthalazinone is a pro-apoptotic protein that inhibits the activity of amines and chloride ions in cancer cells. It can be used to induce apoptosis, which is programmed cell death. The mechanism of 4-phenyl-1(2H)-phthalazinone's activity is through inhibition of inhibitor molecules that are responsible for the transfer of electrons from one molecule to another. This prevents the formation of toxic products, such as hydrogen peroxide, which has been shown to inhibit cancer cell proliferation. 4-Phenyl-1(2H)-phthalazinone also induces apoptosis by inhibiting the enzyme cyclooxygenase (COX) and blocking its production of prostaglandins, which are involved in inflammation and pain.

Formula: C₁₄H₁₀N₂O

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-FP58912