CAS 5004-48-8
:4-methylphthalazin-1(2H)-one
Description:
4-Methylphthalazin-1(2H)-one, with the CAS number 5004-48-8, is an organic compound characterized by its phthalazine core structure, which is a bicyclic compound containing two fused aromatic rings. This particular derivative features a methyl group at the 4-position and a carbonyl group at the 1-position, contributing to its unique chemical properties. It is typically a crystalline solid, exhibiting moderate solubility in polar organic solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities. Its structure allows for interactions with biological targets, making it a candidate for further research in drug development. Additionally, 4-methylphthalazin-1(2H)-one may participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, owing to the presence of the carbonyl group. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-6-7-4-2-3-5-8(7)9(12)11-10-6/h2-5H,1H3,(H,11,12)
SMILES:Cc1c2ccccc2c(nn1)O
Synonyms:- 1(2H)-Phthalazinone, 4-methyl-
- 1-Phthalazinol, 4-Methyl-
- 4-Methylphthalazin-1-ol
- 4-Methylphthalazin-1(2H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-methyl-1(2H)-phthalazinone
CAS:Formula:C9H8N2OPurity:95%Color and Shape:SolidMolecular weight:160.1726Ref: IN-DA006WDC
1g56.00€5g115.00€10g199.00€25g324.00€50g534.00€100gTo inquire100mg25.00€250mg28.00€500mg50.00€1-Hydroxy-4-methylphthalazine
CAS:1-Hydroxy-4-methylphthalazineFormula:C9H8N2OPurity:98%Color and Shape: off white to faint yellow crystalline powderMolecular weight:160.17g/mol4-Methylphthalazin-1(2H)-one
CAS:Formula:C9H8N2OPurity:98%Color and Shape:Solid, White powderMolecular weight:160.176Hydroxy-4-methylphthalazine
CAS:Hydroxy-4-methylphthalazine is a synthetic molecule that has been shown to inhibit the production of nitric oxide (NO) and other reactive oxygen species. It also inhibits cholinesterase activity, which leads to increased acetylcholine levels. This agent is metabolized by nucleophilic substitutions and may be synthesized from phthalazinone or aminoguanidine. Hydroxy-4-methylphthalazine binds to the redox potentials of molecular targets and can be used as an inhibitor in biological systems.Formula:C9H8N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:160.17 g/molHydroxy-4-methylphthalazine
CAS:Controlled ProductFormula:C9H8N2OColor and Shape:NeatMolecular weight:160.17




