CAS 5005-46-9
:α-[2-[Bis(1-methylethyl)amino]ethyl]-α-phenyl-2-pyridineacetonitrile
Description:
α-[2-[Bis(1-methylethyl)amino]ethyl]-α-phenyl-2-pyridineacetonitrile, with the CAS number 5005-46-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a nitrile functional group. This compound features a bis(1-methylethyl)amino group, indicating the presence of two isopropylamine moieties, which contribute to its basicity and potential reactivity. The α-phenyl group suggests that it may exhibit significant steric hindrance, influencing its interactions and solubility in various solvents. The nitrile group typically imparts polar characteristics, making the compound potentially soluble in polar organic solvents. Additionally, the presence of the pyridine ring may provide aromatic stability and influence the compound's electronic properties. Overall, this compound may be of interest in various chemical applications, including pharmaceuticals and agrochemicals, due to its unique structural features and potential biological activity. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C21H27N3
InChI:InChI=1S/C21H27N3/c1-17(2)24(18(3)4)15-13-21(16-22,19-10-6-5-7-11-19)20-12-8-9-14-23-20/h5-12,14,17-18H,13,15H2,1-4H3
InChI key:InChIKey=SSDIPWVFVFRNKB-UHFFFAOYSA-N
SMILES:C(CCN(C(C)C)C(C)C)(C#N)(C1=CC=CC=C1)C2=CC=CC=N2
Synonyms:- 2-Pyridineacetonitrile, α-[2-(diisopropylamino)ethyl]-α-phenyl-
- 2-Pyridineacetonitrile, α-[2-[bis(1-methylethyl)amino]ethyl]-α-phenyl-
- 4-(Diisopropylamino)-2-phenyl-2-(2-pyridyl)butyronitrile
- 4-(Dipropan-2-Ylamino)-2-Phenyl-2-(Pyridin-2-Yl)Butanenitrile
- alpha-(2-(Bis(isopropyl)amino)ethyl)-alpha-phenylpyridine-2-acetonitrile
- α-[2-[Bis(1-methylethyl)amino]ethyl]-α-phenyl-2-pyridineacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

