CAS 500565-15-1
:6-chloro-9-({4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl}amino)-2-methoxyacridinium chloride
Description:
6-Chloro-9-({4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl}amino)-2-methoxyacridinium chloride is a synthetic organic compound characterized by its complex structure, which includes an acridinium core, a chloro substituent, and a piperazine moiety. This compound typically exhibits properties associated with acridine derivatives, such as potential fluorescence and intercalation capabilities with nucleic acids, making it of interest in biochemical and pharmaceutical research. The presence of the piperazine ring suggests possible interactions with biological targets, enhancing its utility in medicinal chemistry. The hydroxy and methoxy groups contribute to its solubility and reactivity, while the chloride ion may influence its stability and ionic interactions in solution. Overall, this compound's unique structural features position it as a candidate for further investigation in drug development and molecular biology applications. However, specific physical and chemical properties such as melting point, solubility, and spectral characteristics would require empirical determination or literature reference for precise values.
Formula:C26H28Cl2N4O2
InChI:InChI=1/C26H27ClN4O2.ClH/c1-30-9-11-31(12-10-30)16-17-13-19(4-8-25(17)32)28-26-21-6-3-18(27)14-24(21)29-23-7-5-20(33-2)15-22(23)26;/h3-8,13-15,32H,9-12,16H2,1-2H3,(H,28,29);1H
SMILES:CN1CCN(CC1)Cc1cc(ccc1O)N=c1c2ccc(cc2[nH]c2ccc(cc12)OC)Cl.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
HM03
CAS:HM03 is a potent and selective inhibitor of HSPA5, and has anticancer activity.Formula:C26H27ClN4O2Purity:97.15%Color and Shape:SolidMolecular weight:462.97HM03
CAS:HM03 is a monoclonal antibody that binds to the extracellular domain of human epidermal growth factor receptor 2 (HER2) and inhibits its activity. HM03 has been shown to inhibit tumor growth in mice with breast cancer cells. It also has an antibacterial effect on Gram-positive bacteria, such as Staphylococcus aureus, by binding to their cell wall and inhibiting protein synthesis. HM03 can be used as a monoclonal antibody for therapeutic purposes or as a diagnostic marker for cancer cells.
Formula:C26H27ClN4O2Purity:Min. 95%Molecular weight:463 g/mol


