CAS 500568-72-9
:2-({[2-chloro-9-(propan-2-yl)-9H-purin-6-yl]amino}methyl)phenol
Description:
2-({[2-chloro-9-(propan-2-yl)-9H-purin-6-yl]amino}methyl)phenol, identified by its CAS number 500568-72-9, is a chemical compound that features a purine base structure substituted with a chloro group and an isopropyl group, along with a phenolic moiety. This compound is characterized by its complex molecular architecture, which includes an amino group that links the purine and phenol components. The presence of the chloro substituent can influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. The isopropyl group may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. Additionally, the phenolic structure can contribute to hydrogen bonding and interactions with biological targets. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies on its pharmacodynamics and pharmacokinetics would be necessary to fully understand its properties and applications.
Formula:C15H16ClN5O
InChI:InChI=1/C15H16ClN5O/c1-9(2)21-8-18-12-13(19-15(16)20-14(12)21)17-7-10-5-3-4-6-11(10)22/h3-6,8-9,22H,7H2,1-2H3,(H,17,19,20)
SMILES:CC(C)n1cnc2c(NCc3ccccc3O)nc(Cl)nc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Chloro-6-(2-hydroxybenzylamino)-9-isopropylpurine
CAS:Controlled ProductApplications 2-Chloro-6-(2-hydroxybenzylamino)-9-isopropylpurine (cas# 500568-72-9) is a compound useful in organic synthesis.
Formula:C15H16ClN5OColor and Shape:NeatMolecular weight:317.772-Chloro-6-(2-hydroxybenzylamino)-9-isopropylpurine
CAS:2-Chloro-6-(2-hydroxybenzylamino)-9-isopropylpurine (CPI) is a versatile building block that can be used in the synthesis of various compounds. This compound is a useful reagent for the preparation of 1,4-benzoquinones and has been shown to be an effective intermediate for the synthesis of various drugs. It is also a valuable intermediate for the synthesis of 2,4-diaminotoluenes. CPI is a high quality chemical with CAS No. 500568-72-9 and has been shown to react well with many different chemicals.Formula:C15H16ClN5OPurity:Min. 95%Color and Shape:White PowderMolecular weight:317.77 g/mol

