CAS 500579-04-4: 2,2′-[[Dihydro-2-(4-pyridinyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimethylbenzenamine]
Description:2,2′-[[Dihydro-2-(4-pyridinyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimethylbenzenamine], identified by CAS number 500579-04-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrimidine core and multiple aromatic amine functionalities. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. Its structure suggests the presence of multiple functional groups, which may contribute to its reactivity and interactions with biological targets. The presence of pyridine and dimethylamino groups indicates potential for hydrogen bonding and electronic interactions, which can influence its pharmacological properties. Additionally, the compound may exhibit specific optical characteristics, depending on its conformation and substituents. Overall, this substance is likely to be studied for its potential applications in drug development or as a chemical probe in biological research.
Formula:C27H35N5
InChI:InChI=1S/C27H35N5/c1-29(2)25-12-7-5-10-23(25)20-31-18-9-19-32(27(31)22-14-16-28-17-15-22)21-24-11-6-8-13-26(24)30(3)4/h5-8,10-17,27H,9,18-21H2,1-4H3
InChI key:InChIKey=KVQOGDQTWWCZFX-UHFFFAOYSA-N
SMILES:N=1C=CC(=CC1)C2N(CC=3C=CC=CC3N(C)C)CCCN2CC=4C=CC=CC4N(C)C
- Synonyms:
- 2,2′-[[Dihydro-2-(4-pyridinyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimethylbenzenamine]
- 2-[[3-[[2-(Dimethylamino)phenyl]methyl]-2-pyridin-4-yl-1,3-diazinan-1-yl]methyl]-N,N-dimethylaniline
- Benzenamine, 2,2′-[[dihydro-2-(4-pyridinyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimethyl-
- NSC 136476
- GANT 61