CymitQuimica logo

CAS 500770-82-1

:

Benzenepropanoic acid,4-cyano-b-[[(1,1-dimethylethoxy)carbonyl]amino]-,(bS)-

Description:
Benzenepropanoic acid, 4-cyano-b-[[(1,1-dimethylethoxy)carbonyl]amino]-, (bS)-, with the CAS number 500770-82-1, is a chemical compound characterized by its complex structure that includes a benzene ring, a propanoic acid moiety, and a cyano group. This compound features a chiral center, indicated by the (bS)- designation, which suggests it exists in a specific stereoisomeric form. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective groups that can influence its reactivity and solubility. Generally, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making them of interest in pharmaceutical and chemical research. The cyano group can enhance the compound's reactivity, allowing for further chemical modifications. Additionally, the presence of both acidic and basic functional groups suggests that this compound could participate in various chemical reactions, including esterification and amide formation, which are common in organic synthesis.
Formula:C15H18N2O4
InChI:InChI=1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(8-13(18)19)11-6-4-10(9-16)5-7-11/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m0/s1
InChI key:PYMTTWVQVSELBI-LBPRGKRZSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=C(C=C1)C#N
Synonyms:
  • (S)-Boc-4-Cyano-Β-Phe-Oh
  • Boc-b-Phe(4-CN)-OH
  • (S)-3-(Boc-amino)-3-(4-cyanophenyl)propionic acid, Boc-4-cyano-D-β-phenylalanine
  • (S)-Boc-4-Cyano-Beta-Phe-Oh
Found 5 products.