CymitQuimica logo

CAS 500788-91-0

:

(βR)-2,3-Dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]benzenepropanoic acid

Description:
(βR)-2,3-Dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]benzenepropanoic acid, with CAS number 500788-91-0, is a synthetic organic compound characterized by its complex structure, which includes a dichlorobenzene moiety and an amino acid derivative. This compound features a chiral center, indicated by the (βR) designation, which contributes to its stereochemical properties and potential biological activity. The presence of the dichloro substituents suggests that it may exhibit unique reactivity and interactions with biological targets. The (1,1-dimethylethoxy)carbonyl group indicates that it has protective groups that can influence its solubility and stability. As an amino acid derivative, it may participate in various biochemical processes, potentially acting as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound represents a class of molecules that could have significant implications in medicinal chemistry and drug development.
Formula:C14H17Cl2NO4
InChI:InChI=1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-10(7-11(18)19)8-5-4-6-9(15)12(8)16/h4-6,10H,7H2,1-3H3,(H,17,20)(H,18,19)/t10-/m1/s1
InChI key:InChIKey=KGXWCCCBQSYUKL-SNVBAGLBSA-N
SMILES:[C@@H](NC(OC(C)(C)C)=O)(CC(O)=O)C1=C(Cl)C(Cl)=CC=C1
Synonyms:
  • Benzenepropanoic acid, 2,3-dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)-
  • (βR)-2,3-Dichloro-β-[[(1,1-dimethylethoxy)carbonyl]amino]benzenepropanoic acid
Found 4 products.