CAS 500890-58-4: 1-(2-nitrophenyl)imidazolidin-2-one
Description:1-(2-Nitrophenyl)imidazolidin-2-one is a chemical compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a carbonyl group. The presence of the 2-nitrophenyl group introduces a nitro substituent on the aromatic ring, contributing to the compound's potential reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the imidazolidinone core and the nitrophenyl moiety, which can influence biological activity. Additionally, the nitro group may participate in various chemical reactions, such as reduction or nucleophilic substitution, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks.
Formula:C9H9N3O3
InChI:InChI=1/C9H9N3O3/c13-9-10-5-6-11(9)7-3-1-2-4-8(7)12(14)15/h1-4H,5-6H2,(H,10,13)
- Synonyms:
- 1-(2-Nitrophenyl)-2-imidazolidinon
- 1-(2-Nitrophenyl)-2-imidazolidinone
- 2-Imidazolidinone, 1-(2-Nitrophenyl)-
Ref: 10-F526206
| 2g | To inquire |
1-(2-nitrophenyl)imidazolidin-2-one
Ref: 3D-AVA89058
| 250mg | 410.00 € | ||
| 2500mg | 1,214.00 € |
