CAS 501-34-8
:Penilloic acid
Description:
Penilloic acid, with the CAS number 501-34-8, is a chemical compound that belongs to the class of fatty acids. It is characterized by its carboxylic acid functional group, which imparts acidic properties. This compound is typically a colorless to pale yellow liquid, exhibiting a distinctive odor. Penilloic acid is known for its solubility in organic solvents, while its solubility in water is limited. The molecular structure includes a long hydrocarbon chain, contributing to its hydrophobic characteristics. It is often studied for its potential applications in various fields, including biochemistry and materials science. Additionally, penilloic acid may participate in various chemical reactions, such as esterification and amidation, making it a versatile compound in synthetic organic chemistry. Its biological relevance is also notable, as it may play a role in metabolic pathways or serve as a precursor for other biologically active molecules. Overall, penilloic acid is a compound of interest due to its unique properties and potential applications in both industrial and research settings.
Formula:C15H20N2O3S
InChI:InChI=1S/C15H20N2O3S/c1-15(2)13(14(19)20)17-12(21-15)9-16-11(18)8-10-6-4-3-5-7-10/h3-7,12-13,17H,8-9H2,1-2H3,(H,16,18)(H,19,20)
InChI key:InChIKey=LRWFMQCGNBOTQP-UHFFFAOYSA-N
SMILES:C(NC(CC1=CC=CC=C1)=O)C2NC(C(O)=O)C(C)(C)S2
Synonyms:- 4-Thiazolidinecarboxylic acid, 5,5-dimethyl-2-[(2-phenylacetamido)methyl]-
- 4-Thiazolidinecarboxylic acid, 5,5-dimethyl-2-[[(2-phenylacetyl)amino]methyl]-
- 4-Thiazolidinecarboxylic acid, 5,5-dimethyl-2-[[(phenylacetyl)amino]methyl]-
- 5,5-Dimethyl-2-[[(2-phenylacetyl)amino]methyl]-4-thiazolidinecarboxylic acid
- 5,5-Dimethyl-2-{[(2-Phenylacetyl)Amino]Methyl}-1,3-Thiazolane-4-Carboxylic Acid
- Benzylpenilloic acid
- Penilloate
- Penilloic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2RS,4S)-2-[[(Phenylacetyl)amino]methyl]-5,5-dimethylthiazolidine-4-carboxylic Acid (Penilloic Acids of Benzylpenicillin)
CAS:Controlled ProductFormula:C15H20N2O3SColor and Shape:NeatMolecular weight:308.40(2RS,4S)-5,5-Dimethyl-2-((2-phenylacetamido)methyl)thiazolidine-4-carboxylic acid (mixture of diastereomers)
CAS:Controlled ProductFormula:C15H20N2O3SColor and Shape:NeatMolecular weight:308.4(2RS,4S)-2-[[(phenylacetyl)amino]methyl]-5,5-dimethylthiazolidine-4-carboxylic acid (penilloic acids of benzylpenicillin)
CAS:<p>(2RS,4S)-2-[[(Phenylacetyl)amino]methyl]-5,5-dimethylthiazolidine-4-carboxylic acid, commonly referred to as penilloic acids, is a hydrolytic degradation product of benzylpenicillin. It is derived through the enzymatic or chemical cleavage of the β-lactam ring of benzylpenicillin, which is a classic β-lactam antibiotic.</p>Formula:C15H20N2O3SPurity:Min. 95%Molecular weight:308.4 g/molBenzylpenicillin Potassium EP Impurity F (Benzylpenicillin (Benzathine) EP Impurity F, Benzylpenicillin (Procaine) EP Impurity C, Benzylpenicillin Sodium EP Impurity F) (Mixture of Diastereomers)
CAS:Formula:C15H20N2O3SColor and Shape:White To Off-White SolidMolecular weight:308.40Ref: 4Z-P-0415
Discontinued product



