CAS 501081-38-5

N1,N7-Bis[3-(dimethylamino)propyl]-3,9-dimethylquino[8,7-h]quinoline-1,7-diamine

Description:

N1,N7-Bis[3-(dimethylamino)propyl]-3,9-dimethylquino[8,7-h]quinoline-1,7-diamine, with CAS number 501081-38-5, is a synthetic organic compound characterized by its complex quinoid structure, which incorporates multiple functional groups, including dimethylamino and amine functionalities. This compound typically exhibits properties such as solubility in organic solvents, which may vary based on the specific solvent and conditions. Its structure suggests potential applications in fields such as medicinal chemistry, particularly in the development of pharmaceuticals or as a dye due to its conjugated system that can absorb light. The presence of dimethylamino groups may impart basicity, influencing its reactivity and interaction with biological systems. Additionally, the compound's unique quinoid framework may contribute to its electronic properties, making it of interest in materials science and organic electronics. As with many synthetic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be thoroughly evaluated in any practical applications.

Formula: C₂₈H₃₈N₆

InChI: InChI=1S/C28H38N6/c1-19-17-25(29-13-7-15-33(3)4)23-11-10-22-21(27(23)31-19)9-12-24-26(18-20(2)32-28(22)24)30-14-8-16-34(5)6/h9-12,17-18H,7-8,13-16H2,1-6H3,(H,29,31)(H,30,32)

InChI key: InChIKey=WJUPENLNVUCETH-UHFFFAOYSA-N

SMILES: N(CCCN(C)C)C1=C2C(C3=C(C=4C(C=C3)=C(NCCCN(C)C)C=C(C)N4)C=C2)=NC(C)=C1

Synonyms:

• N1,N7-Bis[3-(dimethylamino)propyl]-3,9-dimethylquino[8,7-h]quinoline-1,7-diamine
• Quino[8,7-h]quinoline-1,7-diamine, N1,N7-bis[3-(dimethylamino)propyl]-3,9-dimethyl-
• Quino[8,7-h]quinoline-1,7-diamine, N,N′-bis[3-(dimethylamino)propyl]-3,8-dimethyl-
• NSC 306365

FGI-106

CAS: 501081-38-5

FGI-106 combats Ebola, Rift Valley, Dengue Fever, HCV, and HIV-1; EC50s range from 100-900 nM.

Formula: C₂₈H₃₈N₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 458.64

Ref: TM-T11281