CAS 5014-83-5
:4,5-diphenyl-1,3-oxazol-2(3H)-one
Description:
4,5-Diphenyl-1,3-oxazol-2(3H)-one, with the CAS number 5014-83-5, is an organic compound characterized by its oxazole ring structure, which features two phenyl groups attached to the 4 and 5 positions of the ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The oxazole moiety contributes to its chemical reactivity, allowing it to participate in various organic reactions, such as cycloadditions and nucleophilic substitutions. Additionally, it may exhibit fluorescence properties, making it useful in photochemical applications. The compound's solubility can vary depending on the solvent, and it is generally more soluble in organic solvents than in water. Its stability and reactivity can be influenced by the presence of substituents on the phenyl rings, which can affect electronic properties and steric hindrance. Overall, 4,5-diphenyl-1,3-oxazol-2(3H)-one is a versatile compound with interesting chemical behavior and potential utility in research and industry.
Formula:C15H11NO2
InChI:InChI=1/C15H11NO2/c17-15-16-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10H,(H,16,17)
SMILES:c1ccc(cc1)c1c(c2ccccc2)oc(n1)O
Synonyms:- 2(3H)-oxazolone, 4,5-diphenyl-
- 4,5-Diphenyl-1,3-oxazol-2(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4,5-Diphenyl-2,3-dihydro-1,3-oxazol-2-one
CAS:<p>4,5-Diphenyl-2,3-dihydro-1,3-oxazol-2-one is an antiinflammatory drug that belongs to the group of primary amines. It is a coxib class drug and inhibits COX enzymes by binding to their active site and blocking the formation of prostaglandins. 4,5-Diphenyl-2,3-dihydro-1,3-oxazol-2-one has been found to be selective for COX type 2 inhibition and has been shown to inhibit COX enzyme activity in blood assay experiments. This compound also has a high yield in reaction mixtures and recyclization reactions with benzoin.</p>Formula:C15H11NO2Purity:Min. 95%Molecular weight:237.25 g/mol
