CAS 501697-77-4
:4-(3,4-dichlorophenoxy)benzenesulfonyl chloride
Description:
4-(3,4-Dichlorophenoxy)benzenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a dichlorophenoxy group, indicating the presence of two chlorine atoms on the phenyl ring, which can influence its electronic properties and reactivity. The sulfonyl chloride moiety makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, particularly with amines and alcohols, to form sulfonamides and sulfonates, respectively. The presence of chlorine substituents can enhance the compound's lipophilicity and may affect its biological activity. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to introduce sulfonyl groups into organic molecules. As with many sulfonyl chlorides, it is important to handle this compound with care due to its potential reactivity and the release of hydrochloric acid upon hydrolysis. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C12H7Cl3O3S
InChI:InChI=1/C12H7Cl3O3S/c13-11-6-3-9(7-12(11)14)18-8-1-4-10(5-2-8)19(15,16)17/h1-7H
SMILES:c1cc(ccc1Oc1ccc(c(c1)Cl)Cl)S(=O)(=O)Cl
Synonyms:- Benzenesulfonyl chloride, 4-(3,4-dichlorophenoxy)-
- 4-(3,4-Dichlorophenoxy)benzenesulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(3,4-Dichlorophenoxy)benzenesulphonyl chloride
CAS:4-(3,4-Dichlorophenoxy)benzenesulphonyl chloridePurity:≥95%Color and Shape:White PowderMolecular weight:337.61g/mol4-(3,4-Dichlorophenoxy)benzenesulfonyl chloride
CAS:Formula:C12H7Cl3O3SPurity:95.0%Color and Shape:SolidMolecular weight:337.64-(3,4-Dichlorophenoxy)benzenesulfonyl chloride
CAS:4-(3,4-Dichlorophenoxy)benzenesulfonyl chloride is a sulfonate that is used in the synthesis of organic compounds. It has been shown to have torsion, oriented, and nucleophilic properties. The phenol group of 4-(3,4-dichlorophenoxy)benzenesulfonyl chloride has been shown to be nucleophilic in nature. The phenyl group is electron donating and the chloride atom is electron withdrawing. The crystal structure of 4-(3,4-dichlorophenoxy)benzenesulfonyl chloride is as follows:Formula:C12H7Cl3O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:337.61 g/mol


