CAS 5018-30-4
:1,3-Dimethyl 2-methoxypropanedioate
Description:
1,3-Dimethyl 2-methoxypropanedioate, with the CAS number 5018-30-4, is an organic compound characterized by its ester functional groups. It features a propanedioate backbone, which is a diester derived from malonic acid, with two methyl groups attached to the first carbon and a methoxy group on the second carbon. This structure contributes to its unique chemical properties, including its solubility in organic solvents and potential reactivity in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the methoxy group enhances its polarity, making it more soluble in polar solvents compared to similar compounds without such substituents. Additionally, 1,3-Dimethyl 2-methoxypropanedioate may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and synthetic organic chemistry. Its stability under standard conditions allows for its use in various synthetic applications, although specific handling and safety measures should be observed due to the potential hazards associated with organic esters.
Formula:C6H10O5
InChI:InChI=1/C6H10O5/c1-9-4(5(7)10-2)6(8)11-3/h4H,1-3H3
InChI key:InChIKey=ORXJMBXYSGGCHG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(C(OC)=O)OC
Synonyms:- 1,3-Dimethyl 2-methoxypropanedioate
- 2-Methoxy-malonic acid dimethyl ester
- Dimethyl 2-methoxymalonate
- Dimethyl Methoxypropanedioate
- Malonic acid, methoxy-, dimethyl ester
- Methoxymalonic Acid Dimethyl Ester
- Propanedioic acid, 2-methoxy-, 1,3-dimethyl ester
- Propanedioic acid, methoxy-, dimethyl ester
- Dimethyl methoxymalonate
- 2-Methoxy-malonicaciddimethylester
- Propanedioicacid,methoxy-,dimethylester
- Dimethyltartronate
- Trimethyl tartronate
- Methoxypropanedioic acid dimethyl ester
- Dimethylmethoxymalonate99%
- Methoxymalonsαuredimethylester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl Methoxymalonate
CAS:Formula:C6H10O5Purity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:162.14Dimethyl 2-methoxymalonate
CAS:Formula:C6H10O5Purity:96%Color and Shape:LiquidMolecular weight:162.1406Ref: IN-DA0034QZ
1g49.00€5g91.00€10g108.00€25g210.00€50g280.00€100g637.00€250gTo inquire500gTo inquire250mg29.00€Dimethyl 2-methoxymalonate
CAS:Dimethyl 2-methoxymalonateFormula:C6H10O5Purity:97%Color and Shape:Colourless To Pale Yellow LiquidMolecular weight:162.14g/molDimethyl Methoxymalonate
CAS:Formula:C6H10O5Purity:95%Color and Shape:Liquid, ClearMolecular weight:162.141Dimethyl Methoxymalonate
CAS:Dimethyl methoxymalonate (DMM) is a synthetic compound that functions as an inhibitor of histone lysine methyltransferases. It may be used to treat cancer and inflammatory bowel disease by inhibiting the growth of cancer cells and reducing inflammation. DMM has been shown to be effective in diabetic patients, as it can improve the optical system in the retina. The drug also has pharmacokinetic properties that are similar to those seen with insulin, making it a potential treatment for insulin resistance and diabetes.Formula:C6H10O5Purity:Min. 95%Molecular weight:162.14 g/mol




