CAS 5018-45-1

4-Amino-5,6-dimethoxypyrimidine

Description:

4-Amino-5,6-dimethoxypyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and two methoxy groups (-OCH3) at the 5 and 6 positions, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions. The presence of the amino group makes it a potential precursor for the synthesis of pharmaceuticals and agrochemicals, as it can participate in nucleophilic substitution reactions. Additionally, the methoxy groups can influence the compound's reactivity and stability, affecting its interactions in biological systems. Overall, 4-Amino-5,6-dimethoxypyrimidine is of interest in medicinal chemistry and research due to its structural features and potential applications.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-10-4-5(7)8-3-9-6(4)11-2/h3H,1-2H3,(H2,7,8,9)

InChI key: InChIKey=OBYHDGNNFIOYSU-UHFFFAOYSA-N

SMILES: O(C)C=1C(OC)=C(N)N=CN1

Synonyms:

• 4-Amino-5,6-dimethoxypyrimidine
• 4-Pyrimidinamine, 5,6-dimethoxy-
• 5,6-Dimethoxy-4-pyrimidinamine
• 5,6-Dimethoxypyrimidin-4-Amine
• Pyrimidine, 4-amino-5,6-dimethoxy-

5,6-Dimethoxypyrimidin-4-ylamine

CAS: 5018-45-1

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.1546

Ref: IN-DA00DDUE

4-Amino-5,6-dimethoxypyrimidine

CAS: 5018-45-1

4-Amino-5,6-dimethoxypyrimidine

Purity: 98%

Molecular weight: 155.15g/mol

Ref: 54-OR926690

Sulfadoxine Impurity 1 (5,6-Dimethoxypyrimidin-4-Amine)

CAS: 5018-45-1

Formula: C₆H₉N₃O₂

Molecular weight: 155.16

Ref: 4Z-S-060003

Sulfadoxine Impurity 2

CAS: 5018-45-1

Formula: C₆H₉N₃O₂

Molecular weight: 155.16

Ref: ST-EA-CP-S49003

4-Amino-5,6-dimethoxypyrimidine

CAS: 5018-45-1

Formula: C₆H₉N₃O₂

Purity: 97%

Molecular weight: 155.157

Ref: 10-F221576

4-Amino-5,6-dimethoxypyrimidine

Controlled Product

CAS: 5018-45-1

Formula: C₆H₉N₃O₂

Color and Shape: Neat

Molecular weight: 155.15

Ref: TR-A605155

4-Amino-5,6-dimethoxypyrimidine

CAS: 5018-45-1

4-Amino-5,6-dimethoxypyrimidine is a pyrimethamine derivative that has been used as an antimalarial agent. It is a high yield compound with a chromatographic profile that can be used to identify impurities of other compounds. 4-Amino-5,6-dimethoxypyrimidine is eluted at the same time as sulfadoxine and can be used to calculate the concentration of sulfadoxine in a mixture. It can also be used as a reagent for rp-hplc. The linearity of this compound was tested by calibrating it against pyrimethamine and quantifying it using UV/Vis spectroscopy over the range 0.05 to 1 mg/mL.

Formula: C₆H₉N₃O₂

Purity: Min. 95%

Molecular weight: 155.15 g/mol

Ref: 3D-IA34066