CymitQuimica logo

CAS 5018-45-1

:

4-Amino-5,6-dimethoxypyrimidine

Description:
4-Amino-5,6-dimethoxypyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and two methoxy groups (-OCH3) at the 5 and 6 positions, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions. The presence of the amino group makes it a potential precursor for the synthesis of pharmaceuticals and agrochemicals, as it can participate in nucleophilic substitution reactions. Additionally, the methoxy groups can influence the compound's reactivity and stability, affecting its interactions in biological systems. Overall, 4-Amino-5,6-dimethoxypyrimidine is of interest in medicinal chemistry and research due to its structural features and potential applications.
Formula:C6H9N3O2
InChI:InChI=1S/C6H9N3O2/c1-10-4-5(7)8-3-9-6(4)11-2/h3H,1-2H3,(H2,7,8,9)
InChI key:InChIKey=OBYHDGNNFIOYSU-UHFFFAOYSA-N
SMILES:O(C)C=1C(OC)=C(N)N=CN1
Synonyms:
  • 4-Amino-5,6-dimethoxypyrimidine
  • 4-Pyrimidinamine, 5,6-dimethoxy-
  • 5,6-Dimethoxy-4-pyrimidinamine
  • 5,6-Dimethoxypyrimidin-4-Amine
  • Pyrimidine, 4-amino-5,6-dimethoxy-
Found 8 products.