CAS 5018-45-1
:4-Amino-5,6-dimethoxypyrimidine
Description:
4-Amino-5,6-dimethoxypyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and two methoxy groups (-OCH3) at the 5 and 6 positions, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions. The presence of the amino group makes it a potential precursor for the synthesis of pharmaceuticals and agrochemicals, as it can participate in nucleophilic substitution reactions. Additionally, the methoxy groups can influence the compound's reactivity and stability, affecting its interactions in biological systems. Overall, 4-Amino-5,6-dimethoxypyrimidine is of interest in medicinal chemistry and research due to its structural features and potential applications.
Formula:C6H9N3O2
InChI:InChI=1S/C6H9N3O2/c1-10-4-5(7)8-3-9-6(4)11-2/h3H,1-2H3,(H2,7,8,9)
InChI key:InChIKey=OBYHDGNNFIOYSU-UHFFFAOYSA-N
SMILES:O(C)C=1C(OC)=C(N)N=CN1
Synonyms:- 4-Amino-5,6-dimethoxypyrimidine
- 4-Pyrimidinamine, 5,6-dimethoxy-
- 5,6-Dimethoxy-4-pyrimidinamine
- 5,6-Dimethoxypyrimidin-4-Amine
- Pyrimidine, 4-amino-5,6-dimethoxy-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Amino-5,6-dimethoxypyrimidine
CAS:4-Amino-5,6-dimethoxypyrimidineFormula:C6H9N3O2Purity:>98%Molecular weight:155.154564-Amino-5,6-dimethoxypyrimidine
CAS:Formula:C6H9N3O2Purity:97%Color and Shape:SolidMolecular weight:155.15464-Amino-5,6-dimethoxypyrimidine
CAS:4-Amino-5,6-dimethoxypyrimidineFormula:C6H9N3O2Purity:97%Molecular weight:155.164-Amino-5,6-dimethoxypyrimidine
CAS:Controlled ProductFormula:C6H9N3O2Color and Shape:NeatMolecular weight:155.154-Amino-5,6-dimethoxypyrimidine
CAS:4-Amino-5,6-dimethoxypyrimidine is a pyrimethamine derivative that has been used as an antimalarial agent. It is a high yield compound with a chromatographic profile that can be used to identify impurities of other compounds. 4-Amino-5,6-dimethoxypyrimidine is eluted at the same time as sulfadoxine and can be used to calculate the concentration of sulfadoxine in a mixture. It can also be used as a reagent for rp-hplc. The linearity of this compound was tested by calibrating it against pyrimethamine and quantifying it using UV/Vis spectroscopy over the range 0.05 to 1 mg/mL.
Formula:C6H9N3O2Purity:Min. 95%Molecular weight:155.15 g/mol







