CAS 501892-99-5
:3-Methyl-5-benzofurancarboxylic acid
Description:
3-Methyl-5-benzofurancarboxylic acid is an organic compound characterized by its unique structure, which includes a benzofuran moiety and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methyl group at the 3-position and the carboxylic acid at the 5-position contributes to its chemical reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, such as esterification or amidation, due to the reactive carboxylic acid group. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. Overall, 3-Methyl-5-benzofurancarboxylic acid is a versatile compound with potential applications in various fields, including materials science and drug development.
Formula:C10H8O3
InChI:InChI=1S/C10H8O3/c1-6-5-13-9-3-2-7(10(11)12)4-8(6)9/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=ICGCSXAZTJXZAG-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC=C(C(O)=O)C2)OC1
Synonyms:- 3-Methyl-5-benzofurancarboxylic acid
- 3-Methylbenzofuran-5-carboxylic acid
- 5-Benzofurancarboxylic acid, 3-methyl-
- 3-Methyl-1-benzofuran-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Methylbenzofuran-5-carboxylic acid
CAS:3-Methylbenzofuran-5-carboxylic acidPurity:95%Molecular weight:176.17g/mol3-Methyl-1-benzofuran-5-carboxylic acid
CAS:3-Methyl-1-benzofuran-5-carboxylic acid is a synthetic compound that has been shown to induce apoptosis in human malignant melanoma cells. It inhibits the proliferation of these cells and induces cell death by an apoptotic mechanism. 3-Methyl-1-benzofuran-5-carboxylic acid has anti-proliferative effects on a variety of human malignant cells including those from breast, colon, and prostate cancers, as well as those with leukemia. Cell death was induced in all cases by an apoptotic mechanism. Addition of the compound to cultured cells at concentrations below its IC50 value resulted in a dose dependent inhibition of cell proliferation.Formula:C10H8O3Purity:Min. 95%Molecular weight:176.17 g/mol


