CAS 5019-25-0
:methyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside
Description:
Methyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside is a glycoside derivative of galactose, characterized by the presence of four acetyl groups attached to the hydroxyl groups at positions 2, 3, 4, and 6 of the galactopyranose ring. This compound is typically a white to off-white crystalline solid, soluble in organic solvents such as chloroform and methanol, but less soluble in water due to its acetylation. The acetyl groups enhance the stability and lipophilicity of the molecule, making it useful in various chemical reactions, particularly in carbohydrate chemistry and synthesis. It serves as a protective group in glycosylation reactions and is often employed in the synthesis of more complex carbohydrates and glycosides. The beta configuration indicates the orientation of the hydroxyl group at the anomeric carbon, which is crucial for its reactivity and interactions in biochemical processes. Overall, methyl 2,3,4,6-tetra-O-acetyl-beta-D-galactopyranoside is a valuable compound in both synthetic organic chemistry and biochemistry.
Formula:C15H22O10
InChI:InChI=1/C15H22O10/c1-7(16)21-6-11-12(22-8(2)17)13(23-9(3)18)14(24-10(4)19)15(20-5)25-11/h11-15H,6H2,1-5H3/t11-,12+,13+,14-,15-/m1/s1
Synonyms:- Methyl tetraacetyl-.beta.-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside
CAS:<p>Methyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside is a high purity methylated glycosylated oligosaccharide. This product has been custom synthesized on demand using state of the art technology and is available in a variety of purities and modifications.<br> Methyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside is used as a fluorescent probe for carbohydrate binding proteins. It has also been used in the synthesis of glycoproteins.</p>Formula:C15H22O10Purity:Min. 95%Molecular weight:362.33 g/mol

