CAS 5019-91-0

Bicyclo[2.2.2]octane-2-methanol

Description:

Bicyclo[2.2.2]octane-2-methanol, with the CAS number 5019-91-0, is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[2.2.2]octane framework with a hydroxymethyl group (-CH2OH) attached to one of the bridgehead carbons. This compound is typically a colorless liquid or solid at room temperature, exhibiting moderate polarity due to the presence of the hydroxymethyl group. Its molecular structure contributes to its interesting chemical reactivity, allowing for potential applications in organic synthesis and materials science. Bicyclo[2.2.2]octane derivatives are known for their stability and can serve as building blocks in the synthesis of more complex molecules. The compound's physical properties, such as boiling point and solubility, can vary depending on the specific conditions and purity. Additionally, it may exhibit interesting interactions with other chemical species, making it a subject of interest in various fields, including medicinal chemistry and polymer science. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₆O

InChI: InChI=1S/C9H16O/c10-6-9-5-7-1-3-8(9)4-2-7/h7-10H,1-6H2

InChI key: InChIKey=CYJSENHSYHIVTH-UHFFFAOYSA-N

SMILES: C(O)C1C2CCC(C1)CC2

Synonyms:

• NSC 167506
• [Bicyclo[2.2.2]octan-2-yl]methanol
• 2-Hydroxymethyl-bicyclo[2.2.2]octane
• Bicyclo[2.2.2]octane-2-methanol

{Bicyclo[2.2.2]octan-2-yl}methanol

CAS: 5019-91-0

Versatile small molecule scaffold

Formula: C₉H₁₆O

Purity: Min. 95%

Molecular weight: 140.22 g/mol

Ref: 3D-FAA01991