CymitQuimica logo

CAS 501902-78-9

:

5-[4-(2-Methylpropyl)phenyl]-1H-pyrazol-3-amine

Description:
5-[4-(2-Methylpropyl)phenyl]-1H-pyrazol-3-amine, with the CAS number 501902-78-9, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group substituted with a 2-methylpropyl group at the para position, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The presence of an amine functional group at the 3-position of the pyrazole ring suggests that it may participate in hydrogen bonding, which can affect its solubility and reactivity. The molecular structure indicates that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's unique substituents may impart specific physical properties, such as melting point and solubility, which are crucial for its application in various chemical and pharmaceutical contexts. Overall, this compound's structural features suggest potential utility in drug development and research applications.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c1-9(2)7-10-3-5-11(6-4-10)12-8-13(14)16-15-12/h3-6,8-9H,7H2,1-2H3,(H3,14,15,16)
InChI key:InChIKey=KQJFZAKQQVPXDJ-UHFFFAOYSA-N
SMILES:NC=1C=C(NN1)C2=CC=C(CC(C)C)C=C2
Synonyms:
  • 5-[4-(2-Methylpropyl)phenyl]-1H-pyrazol-3-amine
  • 1H-Pyrazol-3-amine, 5-[4-(2-methylpropyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.