CAS 501944-65-6

(6-Fluorobenzo[b]thiophen-2-yl)boronicacid

Description:

(6-Fluorobenzo[b]thiophen-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorinated benzo[b]thiophene moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential reactivity due to the boronic acid group, which can participate in various chemical reactions, including Suzuki coupling and other cross-coupling reactions. The fluorine atom in the structure can influence the electronic properties and lipophilicity of the compound, making it of interest in medicinal chemistry and materials science. Additionally, the presence of the thiophene ring contributes to its aromatic character and may enhance its stability and reactivity. Overall, (6-Fluorobenzo[b]thiophen-2-yl)boronic acid is valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features and functional versatility.

Formula: C₈H₆BFO₂S

InChI: InChI=1S/C8H6BFO2S/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-4,11-12H

SMILES: c1cc(cc2c1cc(B(O)O)s2)F

6-Fluorobenzo[b]thiene-2-boronic acid

CAS: 501944-65-6

Formula: C₈H₆BFO₂S

Purity: 95%

Molecular weight: 196.0064

Ref: IN-DA00DFT2

6-Fluorobenzo[b]thiophene-2-boronic acid

CAS: 501944-65-6

6-Fluorobenzo[b]thiophene-2-boronic acid

Purity: ≥95%

Molecular weight: 196.01g/mol

Ref: 54-PC412019