CAS 502-26-1
:γ-Stearolactone
Description:
γ-Stearolactone, with the CAS number 502-26-1, is a cyclic ester derived from stearic acid. It is characterized by its lactone structure, which features a carbonyl group adjacent to an ether linkage, forming a five-membered ring. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. γ-Stearolactone is known for its fatty, waxy odor and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. It is often utilized in the cosmetic and fragrance industries due to its pleasant scent and emollient properties. Additionally, γ-stearolactone can serve as a precursor in the synthesis of various chemical compounds and may exhibit biological activity, making it of interest in pharmaceutical research. Its stability and relatively low toxicity further enhance its applicability in various formulations. As with any chemical substance, proper handling and safety measures should be observed to mitigate any potential risks associated with its use.
Formula:C18H34O2
InChI:InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-18(19)20-17/h17H,2-16H2,1H3
InChI key:InChIKey=GYDWWIHJZSCRGV-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)C1CCC(=O)O1
Synonyms:- 2(3H)-furanone, dihydro-5-tetradecyl-
- 4-Octadecanolide
- 5-Tetradecyl-γ-butyrolactone
- 5-Tetradecyldihydro-2(3H)-furanone
- Dihydro-5-tetradecyl-2(3H)-furanone
- Gamma Octadecalactone
- NSC 34907
- Octadecanoic acid, 4-hydroxy-, γ-lactone
- γ-Octadecalactone
- γ-Stearolactone
- 5-Tetradecyldihydrofuran-2(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Tetradecyldihydro-2(3H)-furanone
CAS:Formula:C18H34O2Purity:95%Color and Shape:SolidMolecular weight:282.46145-Tetradecyldihydrofuran-2(3H)-one
CAS:5-Tetradecyldihydrofuran-2(3H)-onePurity:98%Molecular weight:282.46g/mol5-Tetradecyldihydrofuran-2(3H)-one
CAS:5-Tetradecyldihydrofuran-2(3H)-one is a natural product that has been found in a variety of plant species, including plants from the genus Cinnamomum. It is an epidermal irritant and can be used in the laboratory to produce aerosols. This compound may have functions related to chemistry, natural products, and environmental health research. 5-Tetradecyldihydrofuran-2(3H)-one has been found to act as a lactone and has glandular properties. 5-Tetradecyldihydrofuran-2(3H)-one was first isolated from the bark of Cinnamomum japonicum trees in Japan.Formula:C18H34O2Purity:Min. 95%Color and Shape:PowderMolecular weight:282.5 g/mol




