CAS 502-31-8
:Gorlic acid
Description:
Gorlic acid, known scientifically as 1-hexadecanesulfonic acid, is a long-chain fatty acid characterized by its hydrophobic hydrocarbon tail and a sulfonic acid functional group. It is a colorless to pale yellow solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Gorlic acid is primarily used in the synthesis of surfactants, detergents, and emulsifiers, owing to its amphiphilic properties, which allow it to interact with both polar and nonpolar substances. The presence of the sulfonic acid group enhances its ability to form micelles and stabilize emulsions. Additionally, Gorlic acid can serve as a precursor for various chemical reactions, including the formation of sulfonamides and other derivatives. Its applications extend to the fields of pharmaceuticals, cosmetics, and materials science, where it plays a role in modifying surface properties and enhancing product performance. Safety data indicates that, like many sulfonic acids, it should be handled with care due to potential irritant effects.
Formula:C18H30O2
InChI:InChI=1S/C18H30O2/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h2,4,11,14,17H,1,3,5-10,12-13,15-16H2,(H,19,20)
InChI key:InChIKey=XADKGDBMULSEAC-UHFFFAOYSA-N
SMILES:C(CCCCCC=CCCCCC(O)=O)C1CCC=C1
Synonyms:- 13-(2-Cyclopenten-1-yl)-6-tridecenoic acid
- 6-Tridecenoic acid, 13-(2-cyclopenten-1-yl)-
- NSC 313951
- Gorlic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Gorlic acid
CAS:Gorlic acid is a medicinal compound that acts as an inhibitor of kinase proteins in humans. It is an analog of a naturally occurring compound found in Chinese herbs and has been shown to have anticancer properties. Gorlic acid induces apoptosis, or programmed cell death, in cancer cells and has been studied for its potential use in the treatment of leukemia and other tumors. This compound also acts as an inhibitor of urinary protein excretion and may have applications in the treatment of kidney disease.Formula:C18H30O2Purity:Min. 95%Molecular weight:278.4 g/mol
