CAS 502-32-9
:Leucinol
Description:
Leucinol, with the CAS number 502-32-9, is an organic compound that belongs to the class of amino alcohols. It is structurally related to the amino acid leucine, featuring a hydroxyl group (-OH) attached to the carbon chain. This compound is typically characterized by its white crystalline appearance and is soluble in water and alcohols, which is indicative of its polar nature due to the presence of the hydroxyl group. Leucinol exhibits properties that make it useful in various applications, including as a potential building block in organic synthesis and in the formulation of pharmaceuticals. Its amino alcohol structure allows it to participate in various chemical reactions, such as esterification and amination. Additionally, leucinol may have biological significance, as compounds related to amino acids often play roles in metabolic pathways. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C6H15NO
InChI:InChI=1S/C6H15NO/c1-5(2)3-6(7)4-8/h5-6,8H,3-4,7H2,1-2H3
InChI key:InChIKey=VPSSPAXIFBTOHY-UHFFFAOYSA-N
SMILES:C(CC(C)C)(CO)N
Synonyms:- (1-Hydroxymethyl-3-methylbutyl)amine
- 1-Hydroxy-4-methylpentan-2-amine
- 1-Pentanol, 2-Amino-4-Methyl-
- 2-Amino-4-methyl-1-pentanol
- 2-Aminoisohexyl alcohol
- <span class="text-smallcaps">DL</span>-Leucinol
- L-2-Amino-4-Methyl-1-Pentanol
- Leucinol
- dl-Leucinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Pentanol, 2-amino-4-methyl-
CAS:Formula:C6H15NOPurity:98%Color and Shape:SolidMolecular weight:117.18942-Amino-4-methylpentan-1-ol
CAS:Formula:C6H15NOPurity:97%Color and Shape:LiquidMolecular weight:117.192DL-leucinol
CAS:DL-Leucinol is a chiral intermediate that is commonly used in the synthesis of various pharmaceuticals and specialty chemicals. It is synthesized from sources such as amino acids, specifically leucine, and undergoes a series of chemical reactions to be converted into its final form. The mode of action of DL-leucinol primarily involves serving as a building block or intermediate in chemical syntheses, where its stereochemical properties are leveraged to produce enantiomerically enriched compounds.
Formula:C6H15NOPurity:Min. 95%Molecular weight:117.19 g/mol



