CAS 502-37-4
:(αS,1R)-α-[[(4S)-4-Amino-4-carboxy-1-oxobutyl]amino]-2-methylenecyclopropanepropanoic acid
Description:
The chemical substance known as (αS,1R)-α-[[(4S)-4-Amino-4-carboxy-1-oxobutyl]amino]-2-methylenecyclopropanepropanoic acid, with the CAS number 502-37-4, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including amino and carboxylic acid groups, which contribute to its potential biological activity. The presence of a cyclopropane ring adds to its structural complexity, influencing its reactivity and interactions with biological systems. This compound is often studied in the context of medicinal chemistry and biochemistry, particularly for its role as an amino acid analog or in the development of pharmaceuticals. Its stereochemistry, indicated by the specific configuration at various chiral centers, is crucial for its biological function and activity. Overall, this substance exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in various scientific research fields.
Formula:C12H18N2O5
InChI:InChI=1S/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8+,9+/m1/s1
InChI key:InChIKey=UYDZYCPIQSRXKU-VGMNWLOBSA-N
SMILES:C([C@H](NC(CC[C@@H](C(O)=O)N)=O)C(O)=O)[C@@H]1C(=C)C1
Synonyms:- Alanine, L-γ-glutamyl-3-[(1R)-methylenecyclopropyl]-
- Glutamine, N-[1-carboxy-2-(methylenecyclopropyl)ethyl]-
- Cyclopropanepropanoic acid, α-[[(4S)-4-amino-4-carboxy-1-oxobutyl]amino]-2-methylene-, (αS,1R)-
- Hypoglycine B
- Alanine, N-L-γ-glutamyl-3-(methylenecyclopropyl)-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Hypoglycine B
CAS:Controlled Product<p>Applications Hypoglycine B is a toxic organic compound found in the seeds of the Ackee (Blighia sapida) fruit and is a causative agent of Jamaican Vomiting Sickness.<br>References Bowen-Forbes, C. et al.: J. Agri. Food Chem., 59, 3869 (2011); Dundee, S. et al.: Food Res. Int., 47, 306 (2012);<br></p>Formula:C12H18N2O5Color and Shape:NeatMolecular weight:270.282Hypoglycine B
CAS:<p>Hypoglycine B is a potent anticancer agent that has been shown to inhibit the activity of protein kinases in human cancer cells. This Chinese medicinal analog is a kinase inhibitor that can induce apoptosis, or programmed cell death, in tumor cells. Hypoglycine B has been found in the urine of individuals with cancer and may have potential as a therapeutic agent for cancer treatment. Its unique mechanism of action makes it an attractive candidate for further research into novel cancer therapies.</p>Formula:C12H18N2O5Purity:Min. 95%Molecular weight:270.28 g/mol

