CAS 502-47-6: Citronellic acid
Description:Citronellic acid, with the CAS number 502-47-6, is a naturally occurring fatty acid derived from citronella oil, which is extracted from the leaves and stems of lemongrass. This compound is characterized by its long carbon chain, specifically containing a total of 10 carbon atoms and a carboxylic acid functional group, which imparts acidic properties. Citronellic acid is typically a colorless to pale yellow liquid with a pleasant citrus-like odor, making it appealing for use in fragrances and flavorings. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic carbon chain. The compound exhibits antimicrobial and insect-repellent properties, contributing to its application in personal care products and natural pest control. Additionally, citronellic acid can undergo various chemical reactions, such as esterification, making it useful in the synthesis of esters for use in cosmetics and food industries. Overall, its unique properties and versatility make citronellic acid a valuable substance in both industrial and consumer applications.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)
InChI key:InChIKey=GJWSUKYXUMVMGX-UHFFFAOYSA-N
SMILES:O=C(O)CC(C)CCC=C(C)C
- Synonyms:
- (3R)-3,7-dimethyloct-6-enoate
- (3S)-3,7-dimethyloct-6-enoate
- 3,7-Dimethyl-6-octenoic acid
- 3,7-Dimethyloct-6-Enoic Acid
- 6-Octenoic acid, 3,7-dimethyl-
- Brn 1722960
- FEMA No. 3142
- Rhodinic acid
- Rhodinolic acid
- Citronellic acid
- See more synonyms
- 4-02-00-01610 (Beilstein Handbook Reference)
- Citronellic acid
