CAS 502-64-7
:Neurosporene
Description:
Neurosporene is a carotenoid, a type of pigment found in various organisms, particularly in certain bacteria and fungi. It is characterized by its long hydrocarbon chain, which contributes to its stability and color properties. Neurosporene is typically orange to red in color, reflecting its role in light absorption and protection against oxidative stress. The compound is a precursor in the biosynthetic pathway of other carotenoids, such as lycopene and beta-carotene, and plays a crucial role in photosynthesis and photoprotection. Neurosporene is soluble in organic solvents and has a relatively low molecular weight. Its structure consists of a series of conjugated double bonds, which are responsible for its light-absorbing properties. Additionally, neurosporene has been studied for its potential antioxidant activities and its role in cellular processes. As a compound with the CAS number 502-64-7, it is of interest in both biochemical research and potential applications in food and cosmetic industries due to its vibrant color and beneficial properties.
Formula:C40H58
InChI:InChI=1/C40H58/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-17,19-22,25-31H,13-14,18,23-24,32H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
InChI key:InChIKey=ATCICVFRSJQYDV-XILUKMICSA-N
SMILES:C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)\C)\C)\C)/C)(\CC/C=C(/CCC=C(C)C)\C)/C
Synonyms:- (6E,8E,10E,12E,14E,16E,18E,20E,22E,26E)-2,6,10,14,19,23,27,31-Octamethyl-2,6,8,10,12,14,16,18,20,22,26,30-dotriacontadodecaene
- 2,6,8,10,12,14,16,18,20,22,26,30-Dotriacontadodecaene, 2,6,10,14,19,23,27,31-octamethyl-
- 7,8-Dihydro-ψ,ψ-carotene
- Lycopene, 7,8-dihydro-, all-trans-
- Neurosporene
- Neurosporin
- Psi,Psi-Carotene, 7,8-Dihydro-
- all-trans-Neurosporene
- ψ,ψ-Carotene, 7,8-dihydro-
- Lycopene Impurity 4
- 7,8-Dihydrolycopene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Neurosporene
CAS:Neurosporene is a phytoene, a type of carotenoid. It can be found in the human serum and can be produced by the reaction between lycopene and hydroxyl group. Neurosporene has been shown to have a protective effect against congestive heart disease. The reaction mechanism is not well-understood, but it may be due to its ability to stimulate the production of nitric oxide. In addition, neurosporene has been shown to have antibacterial activity against bacterial strains that are resistant to antibiotics.
Formula:C40H58Purity:Min. 95%Color and Shape:Red PowderMolecular weight:538.89 g/mol

