CAS 502-70-5

(2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-Tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedial

Description:

The chemical substance known as (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-Tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedial, with the CAS number 502-70-5, is a polyunsaturated aldehyde characterized by a long carbon chain and multiple conjugated double bonds. This compound features a complex structure with a total of 16 carbon atoms, including several methyl groups that contribute to its branched nature. The presence of multiple double bonds indicates that it may exhibit significant reactivity, particularly in addition reactions. The aldehyde functional groups at both ends of the carbon chain suggest that it can participate in various chemical reactions, including oxidation and condensation. Additionally, the conjugated system of double bonds may impart unique optical properties, potentially making it useful in applications such as organic synthesis or as a precursor in the production of more complex organic molecules. Its specific physical properties, such as boiling point and solubility, would depend on the overall structure and the presence of functional groups.

Formula: C₂₀H₂₄O₂

InChI: InChI=1S/C20H24O2/c1-17(11-7-13-19(3)15-21)9-5-6-10-18(2)12-8-14-20(4)16-22/h5-16H,1-4H3/b6-5+,11-7+,12-8+,17-9+,18-10+,19-13+,20-14+

InChI key: InChIKey=YHCIKUXPWFLCFN-QHUUTLAPSA-N

SMILES: C(\C=C\C=C(\C=O)/C)(=C/C=C/C=C(/C=C/C=C(/C=O)\C)\C)/C

Synonyms:

• 2,4,6,8,10,12,14-Hexadecaheptaenedial, 2,6,11,15-tetramethyl-, (all-E)-
• 2,4,6,8,10,12,14-Hexadecaheptaenedial, 2,6,11,15-tetramethyl-, (2E,4E,6E,8E,10E,12E,14E)-
• Crocetin dialdehyde
• (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-Tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedial
• 8,8′-Diapo-ψ,ψ-carotenedial

(2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-Tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedial

CAS: 502-70-5

Formula: C₂₀H₂₄O₂

Molecular weight: 296.4034

Ref: IN-DA006V6S

Crocetindial

CAS: 502-70-5

Formula: C₂₀H₂₄O₂

Purity: 95%~99%

Molecular weight: 296.41

Ref: BP-BP4509

Crocetindial

CAS: 502-70-5

Crocetindial is a natural compound extracted from the stigmas of the saffron crocus (Crocus sativus). It is derived as an apocarotenoid, a class of organic pigments that play a significant role in various biochemical processes. This compound is characterized by its unique structure, which allows it to potentially act as an antioxidant. Crocetindial's mode of action involves the scavenging of free radicals, thereby mitigating oxidative stress at a cellular level.

Formula: C₂₀H₂₄O₂

Purity: Min. 95%

Color and Shape: Red Powder

Molecular weight: 296.4 g/mol

Ref: 3D-FC57751

Crocetindial

Controlled Product

CAS: 502-70-5

Formula: C₂₀H₂₄O₂

Color and Shape: Neat

Molecular weight: 296.40

Ref: TR-C794965