CAS 502-75-0

11-Hydroxyhexadecanoic acid

Description:

11-Hydroxyhexadecanoic acid, also known as 11-hydroxy palmitic acid, is a long-chain fatty acid characterized by the presence of a hydroxyl group at the 11th carbon of the hexadecanoic acid (palmitic acid) backbone. This compound is typically a white, waxy solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The hydroxyl group imparts unique properties, such as increased polarity and potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. It is often studied for its role in biological systems, particularly in lipid metabolism and membrane structure. Additionally, 11-hydroxyhexadecanoic acid may have applications in the development of surfactants, emulsifiers, and other specialty chemicals. Its presence in various natural sources, including certain plant oils and animal fats, highlights its significance in both biochemistry and industrial applications.

Formula: C₁₆H₃₂O₃

InChI: InChI=1S/C16H32O3/c1-2-3-9-12-15(17)13-10-7-5-4-6-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)

InChI key: InChIKey=YNQGVRJFSHTULP-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCC(O)=O)(CCCCC)O

Synonyms:

• 11-Hydroxyhexadecanoic acid
• Hexadecanoic acid, 11-hydroxy-
• 11-Hydroxypalmitic acid
• Jalapinolic acid

Jalapinolic acid

CAS: 502-75-0

Jalapinolic acid

Purity: ≥98%

Molecular weight: 272.42g/mol

Ref: 54-BUP08158

11-Hydroxyhexadecanoic acid

CAS: 502-75-0

Formula: C16H32O3

Purity: >99%

Color and Shape: Solid

Molecular weight: 272.23

Ref: 48-14-1611

Jalapinolic acid

CAS: 502-75-0

Jalapinolic acid (Builic Acid) is a hydroxypalmitic acid.

Formula: C₁₆H₃₂O₃

Purity: 99.87%

Color and Shape: Solid

Molecular weight: 272.42

Ref: TM-T32253