CymitQuimica logo

CAS 502424-52-4

:

Beta-Oxo-4-Fluoro-Benzenepropanoic Acid 1,1-Dimethylethyl Ester

Description:
Beta-Oxo-4-Fluoro-Benzenepropanoic Acid 1,1-Dimethylethyl Ester, with the CAS number 502424-52-4, is an organic compound characterized by its ester functional group and the presence of a fluorine atom on the aromatic ring. This compound typically exhibits properties associated with esters, such as being relatively non-polar, which influences its solubility in organic solvents rather than water. The presence of the beta-oxo group suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The fluorine substituent can enhance the compound's reactivity and stability, affecting its interactions with biological systems and its potential applications in pharmaceuticals or agrochemicals. Additionally, the bulky 1,1-dimethylethyl group may provide steric hindrance, influencing the compound's reactivity and physical properties. Overall, this compound's unique structure may lead to interesting chemical behavior and potential utility in various fields, including medicinal chemistry and materials science.
Formula:C13H15FO3
InChI:InChI=1S/C13H15FO3/c1-13(2,3)17-12(16)8-11(15)9-4-6-10(14)7-5-9/h4-7H,8H2,1-3H3
InChI key:XJYOXELYRUEXLV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)CC(=O)C1=CC=C(C=C1)F
Found 4 products.