CAS 502496-23-3
:3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride
Description:
3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride is a chemical compound characterized by its hydrazine functional group and the presence of two trifluoromethyl groups attached to a phenyl ring. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for hydrazine derivatives. The trifluoromethyl groups contribute to its unique electronic properties, enhancing its reactivity and making it useful in various synthetic applications, particularly in the field of medicinal chemistry and material science. The hydrochloride form indicates that it is a salt, which can influence its stability and solubility. As with many hydrazine derivatives, it may exhibit biological activity, and thus, handling should be done with care due to potential toxicity. Its CAS number, 502496-23-3, allows for precise identification in chemical databases and literature. Overall, this compound is of interest for its potential applications in organic synthesis and as a building block in the development of more complex molecules.
Formula:C8H7ClF6N2
InChI:InChI=1/C8H6F6N2.ClH/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)16-15;/h1-3,16H,15H2;1H
SMILES:c1c(cc(cc1C(F)(F)F)NN)C(F)(F)F.Cl
Synonyms:- 3,5-Bis(Trifluoromethyl)Phenylhydrazine Hcl
- 3,5-Ditrifluoromethylphenylhydrazine hydrochloride
- 3,5-Bis(trifluoromethy)phenylhydrazine HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6F6N2•HClPurity:98%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:280.63,5-Bis(trifluoromethyl)phenylhydrazine, HCl
CAS:Formula:C8H7ClF6N2Purity:97%Color and Shape:SolidMolecular weight:280.59803,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride
CAS:3,5-Bis(trifluoromethyl)phenylhydrazine hydrochlorideFormula:C8H6F6N2·ClHPurity:98%Color and Shape: off white to dark brown crystalline solidMolecular weight:280.60g/mol3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride
CAS:Formula:C8H7ClF6N2Purity:97%Color and Shape:SolidMolecular weight:280.6



