CAS 502496-24-4
:(4-bromo-2-fluorophenyl)diazanium chloride
Description:
(4-bromo-2-fluorophenyl)diazanium chloride is an organic compound characterized by its diazonium functional group, which is known for its reactivity and utility in various chemical transformations, particularly in aromatic substitution reactions. The presence of both bromine and fluorine substituents on the phenyl ring influences its electronic properties, making it a valuable intermediate in synthetic organic chemistry. The bromine atom can facilitate nucleophilic substitution, while the fluorine atom can affect the stability and reactivity of the diazonium ion. This compound is typically handled with care due to the potential for explosive decomposition, especially when dry. It is soluble in polar solvents, which aids in its application in various chemical reactions, including coupling reactions to form azo compounds. As a diazonium salt, it is often used in dye synthesis and as a reagent in the preparation of other organic compounds. Proper safety measures should be observed when working with this compound due to its reactive nature and potential hazards.
Formula:C6H7BrClFN2
InChI:InChI=1/C6H6BrFN2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H
SMILES:c1cc(c(cc1Br)F)NN.Cl
Synonyms:- (4-Bromo-2-fluorophenyl)hydrazine hydrochloride (1:1)
- Hydrazine, (4-Bromo-2-Fluorophenyl)-, Hydrochloride (1:1)
- 4-Bromo-2-fluorophenylhydrazine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4-bromo-2-fluorophenyl)hydrazine hydrochloride
CAS:Formula:C6H7BrClFN2Purity:98%Color and Shape:SolidMolecular weight:241.48864-Bromo-2-fluorophenylhydrazine hydrochloride
CAS:<p>4-Bromo-2-fluorophenylhydrazine hydrochloride</p>Formula:C6H6BrFN2·ClHPurity:≥95%Color and Shape: red/brown solidMolecular weight:241.49g/mol4-Bromo-2-fluorophenylhydrazine hydrochloride
CAS:<p>Please enquire for more information about 4-Bromo-2-fluorophenylhydrazine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C6H7BrClFN2Purity:Min. 95%Color and Shape:PowderMolecular weight:241.49 g/mol(4-Bromo-2-fluorophenyl)hydrazine hydrochloride
CAS:Formula:C6H7BrClFN2Purity:97%Color and Shape:SolidMolecular weight:241.49



