CAS 502496-29-9

Hydrazine, (2-fluoro-4-iodophenyl)-, hydrochloride (1:1)

Description:

Hydrazine, (2-fluoro-4-iodophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine functional group combined with a substituted aromatic ring. The presence of a fluorine atom and an iodine atom on the phenyl ring contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which enhances its usability in laboratory and industrial settings. The compound may exhibit biological activity, making it of interest for research in medicinal chemistry. Its molecular structure suggests potential for hydrogen bonding and interactions with biological targets. Safety considerations are paramount, as hydrazine derivatives can be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, this compound represents a specific class of hydrazine derivatives with unique properties that may be leveraged in synthetic chemistry and drug development.

Formula: C₆H₆FIN₂·ClH

InChI: InChI=1S/C6H6FIN2.ClH/c7-5-3-4(8)1-2-6(5)10-9;/h1-3,10H,9H2;1H

InChI key: InChIKey=YAHTZRMOKVQZPS-UHFFFAOYSA-N

SMILES: N(N)C1=C(F)C=C(I)C=C1.Cl

Synonyms:

• Hydrazine, (2-fluoro-4-iodophenyl)-, monohydrochloride
• Hydrazine, (2-fluoro-4-iodophenyl)-, hydrochloride (1:1)

2-Fluoro-4-iodophenylhydrazine hydrochloride

CAS: 502496-29-9

2-Fluoro-4-iodophenylhydrazine hydrochloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 288.49g/mol

Ref: 54-PC2744